Difference between revisions of "CPD-8984"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1143 RXN-1143] == * direction: ** LEFT-TO-RIGHT * common name: ** caffeate_o-methyltransferase...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8984 CPD-8984] == * smiles: ** C3(C=CC(C2(C(C1(C=CC=CC=1))O2))=CC=3) * common name: ** cis-...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8984 CPD-8984] == |
| − | * | + | * smiles: |
| − | ** | + | ** C3(C=CC(C2(C(C1(C=CC=CC=1))O2))=CC=3) |
* common name: | * common name: | ||
| − | ** | + | ** cis-stilbene oxide |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=ARCJQKUWGAZPFX-OKILXGFUSA-N |
| + | * molecular weight: | ||
| + | ** 196.248 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[3.3.2.9-RXN]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=98511 98511] |
| − | + | * CHEMSPIDER: | |
| − | + | ** [http://www.chemspider.com/Chemical-Structure.88966.html 88966] | |
| − | + | * HMDB : HMDB59631 | |
| − | + | * CHEBI: | |
| − | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50004 50004] | |
| − | {{#set: | + | * LIGAND-CPD: |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16014 C16014] | |
| − | {{#set: | + | {{#set: smiles=C3(C=CC(C2(C(C1(C=CC=CC=1))O2))=CC=3)}} |
| − | {{#set: | + | {{#set: common name=cis-stilbene oxide}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=ARCJQKUWGAZPFX-OKILXGFUSA-N}} |
| − | {{#set: | + | {{#set: molecular weight=196.248 }} |
| + | {{#set: reversible reaction associated=3.3.2.9-RXN}} | ||
Latest revision as of 19:21, 21 March 2018
Contents
Metabolite CPD-8984
- smiles:
- C3(C=CC(C2(C(C1(C=CC=CC=1))O2))=CC=3)
- common name:
- cis-stilbene oxide
- inchi key:
- InChIKey=ARCJQKUWGAZPFX-OKILXGFUSA-N
- molecular weight:
- 196.248
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
