Difference between revisions of "Tiso gene 9166"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7417 CPD-7417] == * smiles: ** C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O * inchi ke...")
(Created page with "Category:Gene == Gene Tiso_gene_9166 == * Synonym(s): == Reactions associated == * Reaction: AMP5N ** Source: orthology-creinhardtii * Reaction: CMP ** Source...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7417 CPD-7417] ==
+
== Gene Tiso_gene_9166 ==
−
* smiles:
+
−
** C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O
+
−
* inchi key:
+
−
** InChIKey=GVRIYIMNJGULCZ-QLFWQTQQSA-M
+
−
* common name:
+
−
** cis-coumarinic acid-β-D-glucoside
+
−
* molecular weight:
+
−
** 325.294   
+
 
* Synonym(s):
 
* Synonym(s):
−
** coumarinic acid glucoside
 
−
** coumarinate glucoside
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-8036]]
+
* Reaction: [[AMP5N]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-creinhardtii]]
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[CMP]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[DAMPH]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[DCMP]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[DMPH]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[I5NT]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[RXN-14143]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[RXN-7609]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[TPH]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[UMPP]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[X5NT]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways associated ==
 +
* [[PWY-6608]]
 +
* [[PWY-6607]]
 +
* [[PWY-6606]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: reaction associated=AMP5N|CMP|DAMPH|DCMP|DMPH|I5NT|RXN-14143|RXN-7609|TPH|UMPP|X5NT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05839 C05839]
+
{{#set: pathway associated=PWY-6608|PWY-6607|PWY-6606}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62223 62223]
+
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25796113 25796113]
+
−
* HMDB : HMDB60077
+
−
{{#set: smiles=C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O}}
+
−
{{#set: inchi key=InChIKey=GVRIYIMNJGULCZ-QLFWQTQQSA-M}}
+
−
{{#set: common name=cis-coumarinic acid-β-D-glucoside}}
+
−
{{#set: molecular weight=325.294    }}
+
−
{{#set: common name=coumarinic acid glucoside|coumarinate glucoside}}
+
−
{{#set: consumed by=RXN-8036}}
+

Latest revision as of 19:21, 21 March 2018

Gene Tiso_gene_9166

  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_9166&oldid=41096"