Difference between revisions of "CPD-15244"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADP-D-Ribosyl-Acceptors ADP-D-Ribosyl-Acceptors] == * common name: ** an ADP-D-ribosyl acceptor...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15244 CPD-15244] == * smiles: ** CCCCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15244 CPD-15244] == |
+ | * smiles: | ||
+ | ** CCCCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
* common name: | * common name: | ||
− | ** | + | ** 3-oxo-(5Z)-tetradecenoyl-CoA |
+ | * inchi key: | ||
+ | ** InChIKey=KADPWMJVUVWQNK-STFCKWFXSA-J | ||
+ | * molecular weight: | ||
+ | ** 985.829 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-oxo-5-cis-tetradecenoyl-CoA | ||
+ | ** 3-oxo-14:1-Δ5-CoA | ||
+ | ** 3-keto-5-cis-tetradecenoyl-CoA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-14394]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-14393]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659295 90659295] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87707 87707] | ||
+ | {{#set: smiles=CCCCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
+ | {{#set: common name=3-oxo-(5Z)-tetradecenoyl-CoA}} | ||
+ | {{#set: inchi key=InChIKey=KADPWMJVUVWQNK-STFCKWFXSA-J}} | ||
+ | {{#set: molecular weight=985.829 }} | ||
+ | {{#set: common name=3-oxo-5-cis-tetradecenoyl-CoA|3-oxo-14:1-Δ5-CoA|3-keto-5-cis-tetradecenoyl-CoA}} | ||
+ | {{#set: consumed by=RXN-14394}} | ||
+ | {{#set: produced by=RXN-14393}} |
Latest revision as of 19:21, 21 March 2018
Contents
Metabolite CPD-15244
- smiles:
- CCCCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- 3-oxo-(5Z)-tetradecenoyl-CoA
- inchi key:
- InChIKey=KADPWMJVUVWQNK-STFCKWFXSA-J
- molecular weight:
- 985.829
- Synonym(s):
- 3-oxo-5-cis-tetradecenoyl-CoA
- 3-oxo-14:1-Δ5-CoA
- 3-keto-5-cis-tetradecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.