Difference between revisions of "PWY-5175"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GERANYL-PP GERANYL-PP] == * smiles: ** CC(=CCCC(=CCOP([O-])(OP(=O)([O-])[O-])=O)C)C * inchi key...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5175 PWY-5175] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-33...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5175 PWY-5175] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-3398] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** lactucaxanthin biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''3''' reactions in the full pathway |
| − | * [[ | + | * [[RXN-8028]] |
| − | + | ** 1 associated gene(s): | |
| − | * [[ | + | *** [[Tiso_gene_11980]] |
| − | == Reaction(s) | + | ** 3 reconstruction source(s) associated: |
| − | * [ | + | *** [[orthology-athaliana]] |
| + | *** [[orthology-creinhardtii]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8029 RXN-8029] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8030 RXN-8030] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-3398}} | |
| − | + | {{#set: common name=lactucaxanthin biosynthesis}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=3}} | |
| − | + | {{#set: completion rate=33.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Latest revision as of 19:21, 21 March 2018
Pathway PWY-5175
- taxonomic range:
- common name:
- lactucaxanthin biosynthesis
- Synonym(s):
Reaction(s) found
1 reactions found over 3 reactions in the full pathway
- RXN-8028
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
