Difference between revisions of "PWY0-522"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13357 CPD-13357] == * smiles: ** CC(C)(O)C(O)C(=O)[O-] * inchi key: ** InChIKey=JTEYKUFKXGD...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-522 PWY0-522] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13357 CPD-13357] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-522 PWY0-522] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C)(O)C(O)C(=O)[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
−
** InChIKey=JTEYKUFKXGDTEU-VKHMYHEASA-M
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
−
** (2R)-2,3-dihydroxy-3-methylbutanoate
+
** lipoate salvage I
−
* molecular weight:
+
−
** 133.124   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (R)-2,3-dihydroxy-3-methylbutanoate
 
−
** (R)-2,3-dihydroxy-isovalerate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[DMHL]]
+
'''2''' reactions found over '''2''' reactions in the full pathway
−
* [[DHAD_3mob_h]]
+
* [[RXN-8654]]
−
* [[DHAD_3mob]]
+
** 5 associated gene(s):
−
* [[DIHYDROXYISOVALDEHYDRAT-RXN]]
+
*** [[Tiso_gene_4493]]
−
== Reaction(s) known to produce the compound ==
+
*** [[Tiso_gene_4494]]
−
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_17215]]
−
* [[ACETOLACTREDUCTOISOM-RXN]]
+
*** [[Tiso_gene_8713]]
 +
*** [[Tiso_gene_17216]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-8655]]
 +
** 5 associated gene(s):
 +
*** [[Tiso_gene_8713]]
 +
*** [[Tiso_gene_4494]]
 +
*** [[Tiso_gene_17215]]
 +
*** [[Tiso_gene_17216]]
 +
*** [[Tiso_gene_4493]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
* ECOCYC:
−
** [http://www.genome.jp/dbget-bin/www_bget?C04272 C04272]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-522 PWY0-522]
−
* CHEMSPIDER:
+
{{#set: taxonomic range=TAX-2157}}
−
** [http://www.chemspider.com/Chemical-Structure.19951355.html 19951355]
+
{{#set: taxonomic range=TAX-4751}}
−
* CHEBI:
+
{{#set: taxonomic range=TAX-33208}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=49072 49072]
+
{{#set: taxonomic range=TAX-2}}
−
* PUBCHEM:
+
{{#set: common name=lipoate salvage I}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615351 23615351]
+
{{#set: reaction found=2}}
−
* HMDB : HMDB12141
+
{{#set: total reaction=2}}
−
{{#set: smiles=CC(C)(O)C(O)C(=O)[O-]}}
+
{{#set: completion rate=100.0}}
−
{{#set: inchi key=InChIKey=JTEYKUFKXGDTEU-VKHMYHEASA-M}}
+
−
{{#set: common name=(2R)-2,3-dihydroxy-3-methylbutanoate}}
+
−
{{#set: molecular weight=133.124    }}
+
−
{{#set: common name=(R)-2,3-dihydroxy-3-methylbutanoate|(R)-2,3-dihydroxy-isovalerate}}
+
−
{{#set: consumed by=DMHL|DHAD_3mob_h|DHAD_3mob|DIHYDROXYISOVALDEHYDRAT-RXN}}
+
−
{{#set: consumed or produced by=ACETOLACTREDUCTOISOM-RXN}}
+

Latest revision as of 20:21, 21 March 2018

Pathway PWY0-522

Reaction(s) found

2 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY0-522&oldid=41124"