Difference between revisions of "PWY-6963"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ANDROST4ENE ANDROST4ENE] == * smiles: ** CC34(CCC(=O)C=C(CC[CH]1([CH](CCC2(C)(C(CC[CH]12)=O))3)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6963 PWY-6963] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2836 TAX-28...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ANDROST4ENE ANDROST4ENE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6963 PWY-6963] ==
* smiles:
+
* taxonomic range:
** CC34(CCC(=O)C=C(CC[CH]1([CH](CCC2(C)(C(CC[CH]12)=O))3))4)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2836 TAX-2836]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
** InChIKey=AEMFNILZOJDQLW-QAGGRKNESA-N
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 
* common name:
 
* common name:
** androst-4-ene-3,17-dione
+
** ammonia assimilation cycle I
* molecular weight:
+
** 286.413   
+
 
* Synonym(s):
 
* Synonym(s):
** 4-androstene-3,17-dione
+
** GS/GOGAT pathway
** androstenedione
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''4''' reactions found over '''6''' reactions in the full pathway
* [[RXN-12124]]
+
* [[GLNSYN-PWY]]
== Reaction(s) of unknown directionality ==
+
** 0 associated gene:
 +
* [[GLUGLNSYN-PWY]]
 +
** 0 associated gene:
 +
* [[GLUTAMATE-SYNTHASE-NADH-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_11511]]
 +
*** [[Tiso_gene_1154]]
 +
*** [[Tiso_gene_2581]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[manual-primary_network]]
 +
* [[GLUTAMINESYN-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Tiso_gene_14842]]
 +
*** [[Tiso_gene_13754]]
 +
*** [[Tiso_gene_13820]]
 +
*** [[Tiso_gene_6647]]
 +
** 6 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* DRUGBANK : DB01536
+
{{#set: taxonomic range=TAX-2836}}
* NCI:
+
{{#set: taxonomic range=TAX-4751}}
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=9563 9563]
+
{{#set: taxonomic range=TAX-33090}}
* CAS : 63-05-8
+
{{#set: common name=ammonia assimilation cycle I}}
* LIPID_MAPS : LMST02020007
+
{{#set: common name=GS/GOGAT pathway}}
* PUBCHEM:
+
{{#set: reaction found=4}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6128 6128]
+
{{#set: total reaction=6}}
* HMDB : HMDB00053
+
{{#set: completion rate=67.0}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00280 C00280]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16422 16422]
+
* METABOLIGHTS : MTBLC16422
+
{{#set: smiles=CC34(CCC(=O)C=C(CC[CH]1([CH](CCC2(C)(C(CC[CH]12)=O))3))4)}}
+
{{#set: inchi key=InChIKey=AEMFNILZOJDQLW-QAGGRKNESA-N}}
+
{{#set: common name=androst-4-ene-3,17-dione}}
+
{{#set: molecular weight=286.413    }}
+
{{#set: common name=4-androstene-3,17-dione|androstenedione}}
+
{{#set: produced by=RXN-12124}}
+

Latest revision as of 20:21, 21 March 2018

Pathway PWY-6963

Reaction(s) found

4 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links