Difference between revisions of "CPD-468"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6386 PWY-6386] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-468 CPD-468] == * smiles: ** C([O-])(=O)CCCC(C(=O)[O-])[N+] * common name: ** L-2-aminoadip...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-468 CPD-468] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C([O-])(=O)CCCC(C(=O)[O-])[N+] |
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** L-2-aminoadipate |
| + | * inchi key: | ||
| + | ** InChIKey=OYIFNHCXNCRBQI-BYPYZUCNSA-M | ||
| + | * molecular weight: | ||
| + | ** 160.149 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** L-aminoadipic acid | ||
| + | ** L-aminoadipate | ||
| + | ** L-2-amino-hexanedioic acid | ||
| + | ** L-α-aminoadipate | ||
| + | ** L-α-aminoadipic acid | ||
| + | ** L-2-aminoadipic acid | ||
| + | ** L-2-aminohexanedioate | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-8162]] | |
| − | == Reaction(s) | + | * [[RXN-10855]] |
| − | + | * [[1.2.1.31-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[ALLYSINE-DEHYDROG-RXN]] | |
| − | + | * [[2-AMINOADIPATE-AMINOTRANSFERASE-RXN]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 1118-90-7 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6992111 6992111] |
| − | {{#set: | + | * HMDB : HMDB00510 |
| − | {{#set: reaction | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00956 C00956] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.5360261.html 5360261] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58672 58672] | ||
| + | * METABOLIGHTS : MTBLC58672 | ||
| + | {{#set: smiles=C([O-])(=O)CCCC(C(=O)[O-])[N+]}} | ||
| + | {{#set: common name=L-2-aminoadipate}} | ||
| + | {{#set: inchi key=InChIKey=OYIFNHCXNCRBQI-BYPYZUCNSA-M}} | ||
| + | {{#set: molecular weight=160.149 }} | ||
| + | {{#set: common name=L-aminoadipic acid|L-aminoadipate|L-2-amino-hexanedioic acid|L-α-aminoadipate|L-α-aminoadipic acid|L-2-aminoadipic acid|L-2-aminohexanedioate}} | ||
| + | {{#set: produced by=RXN-8162|RXN-10855|1.2.1.31-RXN}} | ||
| + | {{#set: reversible reaction associated=ALLYSINE-DEHYDROG-RXN|2-AMINOADIPATE-AMINOTRANSFERASE-RXN}} | ||
Latest revision as of 19:22, 21 March 2018
Contents
Metabolite CPD-468
- smiles:
- C([O-])(=O)CCCC(C(=O)[O-])[N+]
- common name:
- L-2-aminoadipate
- inchi key:
- InChIKey=OYIFNHCXNCRBQI-BYPYZUCNSA-M
- molecular weight:
- 160.149
- Synonym(s):
- L-aminoadipic acid
- L-aminoadipate
- L-2-amino-hexanedioic acid
- L-α-aminoadipate
- L-α-aminoadipic acid
- L-2-aminoadipic acid
- L-2-aminohexanedioate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 1118-90-7
- PUBCHEM:
- HMDB : HMDB00510
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC58672
"C([O-])(=O)CCCC(C(=O)[O-])[N+" cannot be used as a page name in this wiki.
