Difference between revisions of "Heparan-NAc-Glc-6S"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRROLINE-HYDROXY-CARBOXYLATE PYRROLINE-HYDROXY-CARBOXYLATE] == * smiles: ** C1(=NC(C([O-])=O)C...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Heparan-NAc-Glc-6S Heparan-NAc-Glc-6S] == * common name: ** [heparan sulfate]-α-N-acetyl-...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRROLINE-HYDROXY-CARBOXYLATE PYRROLINE-HYDROXY-CARBOXYLATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Heparan-NAc-Glc-6S Heparan-NAc-Glc-6S] ==
−
* smiles:
+
−
** C1(=NC(C([O-])=O)CC(O)1)
+
−
* inchi key:
+
−
** InChIKey=WFOFKRKDDKGRIK-DMTCNVIQSA-M
+
 
* common name:
 
* common name:
−
** (3R,5S)-1-pyrroline-3-hydroxy-5-carboxylate
+
** [heparan sulfate]-α-N-acetyl-D-glucosamine 6-O-sulfate
−
* molecular weight:
+
−
** 128.107   
+
 
* Synonym(s):
 
* Synonym(s):
−
** L-Δ1-pyrroline 3-hydroxy-5-carboxylate
+
** a heparin N-acetyl-glucosamine 6-O-sulfate
−
** L-1pyrroline-3-hydroxy-5-carboxylate
+
** [heparan sulfate] 6-O-sulfate
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN66-546]]
+
* [[3.1.6.14-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[HYDROXYPYRROLINEDEH-RXN]]
 
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=[heparan sulfate]-α-N-acetyl-D-glucosamine 6-O-sulfate}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926300 46926300]
+
{{#set: common name=a heparin N-acetyl-glucosamine 6-O-sulfate|[heparan sulfate] 6-O-sulfate}}
−
* CHEBI:
+
{{#set: consumed by=3.1.6.14-RXN}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62612 62612]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C04281 C04281]
+
−
* HMDB : HMDB01369
+
−
{{#set: smiles=C1(=NC(C([O-])=O)CC(O)1)}}
+
−
{{#set: inchi key=InChIKey=WFOFKRKDDKGRIK-DMTCNVIQSA-M}}
+
−
{{#set: common name=(3R,5S)-1-pyrroline-3-hydroxy-5-carboxylate}}
+
−
{{#set: molecular weight=128.107    }}
+
−
{{#set: common name=L-Δ1-pyrroline 3-hydroxy-5-carboxylate|L-1pyrroline-3-hydroxy-5-carboxylate}}
+
−
{{#set: consumed by=RXN66-546}}
+
−
{{#set: consumed or produced by=HYDROXYPYRROLINEDEH-RXN}}
+

Latest revision as of 19:22, 21 March 2018

Metabolite Heparan-NAc-Glc-6S

  • common name:
    • [heparan sulfate]-α-N-acetyl-D-glucosamine 6-O-sulfate
  • Synonym(s):
    • a heparin N-acetyl-glucosamine 6-O-sulfate
    • [heparan sulfate] 6-O-sulfate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"heparan sulfate]-α-N-acetyl-D-glucosamine 6-O-sulfate" cannot be used as a page name in this wiki.
"heparan sulfate] 6-O-sulfate" cannot be used as a page name in this wiki.
Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Heparan-NAc-Glc-6S&oldid=41175"