Difference between revisions of "6Z8E10E14Z-5S12R-512-DIHYDROXYI"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13755 CPD-13755] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCC1(C(O)CCC2(C)(C(=O)CC[C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=6Z8E10E14Z-5S12R-512-DIHYDROXYI 6Z8E10E14Z-5S12R-512-DIHYDROXYI] == * smiles: ** CCCCCC=CCC(O)C...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=6Z8E10E14Z-5S12R-512-DIHYDROXYI 6Z8E10E14Z-5S12R-512-DIHYDROXYI] == |
* smiles: | * smiles: | ||
− | ** | + | ** CCCCCC=CCC(O)C=CC=CC=CC(O)CCCC(=O)[O-] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** leukotriene B4 |
+ | * inchi key: | ||
+ | ** InChIKey=VNYSSYRCGWBHLG-AMOLWHMGSA-M | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 335.462 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** (6z,8e,10e,14z)-(5s,12r)-5,12-dihydroxyicosa-6,8,10,14-tetraenoate |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[LEUKOTRIENE-A4-HYDROLASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * CAS : 71160-24-2 | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615214 23615214] |
+ | * HMDB : HMDB01085 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C02165 C02165] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57461 57461] |
− | {{#set: smiles= | + | * METABOLIGHTS : MTBLC57461 |
− | {{#set: | + | {{#set: smiles=CCCCCC=CCC(O)C=CC=CC=CC(O)CCCC(=O)[O-]}} |
− | {{#set: | + | {{#set: common name=leukotriene B4}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=VNYSSYRCGWBHLG-AMOLWHMGSA-M}} |
− | {{#set: common name= | + | {{#set: molecular weight=335.462 }} |
− | {{#set: produced by= | + | {{#set: common name=(6z,8e,10e,14z)-(5s,12r)-5,12-dihydroxyicosa-6,8,10,14-tetraenoate}} |
+ | {{#set: produced by=LEUKOTRIENE-A4-HYDROLASE-RXN}} |
Latest revision as of 19:22, 21 March 2018
Contents
Metabolite 6Z8E10E14Z-5S12R-512-DIHYDROXYI
- smiles:
- CCCCCC=CCC(O)C=CC=CC=CC(O)CCCC(=O)[O-]
- common name:
- leukotriene B4
- inchi key:
- InChIKey=VNYSSYRCGWBHLG-AMOLWHMGSA-M
- molecular weight:
- 335.462
- Synonym(s):
- (6z,8e,10e,14z)-(5s,12r)-5,12-dihydroxyicosa-6,8,10,14-tetraenoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 71160-24-2
- PUBCHEM:
- HMDB : HMDB01085
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57461
"CCCCCC=CCC(O)C=CC=CC=CC(O)CCCC(=O)[O-" cannot be used as a page name in this wiki.