Difference between revisions of "Tiso gene 1604"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URATE URATE] == * smiles: ** C12(NC(=O)NC=1C(=O)NC(=O)N2) * inchi key: ** InChIKey=LEHOTFFKMJEO...") |
(Created page with "Category:Gene == Gene Tiso_gene_1604 == * right end position: ** 10932 * transcription direction: ** NEGATIVE * left end position: ** 8142 * centisome position: ** 35.3584...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_1604 == |
− | * | + | * right end position: |
− | ** | + | ** 10932 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 8142 |
− | * | + | * centisome position: |
− | ** | + | ** 35.35849 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[2.7.8.15-RXN]] | |
− | * [[ | + | ** Source: [[orthology-athaliana]] |
− | == | + | ** Source: [[orthology-esiliculosus]] |
− | * [[ | + | * Reaction: [[PHOSNACMURPENTATRANS-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-11347]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-8975]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6470]] | ||
+ | * [[PWY-6471]] | ||
+ | * [[MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS]] | ||
+ | * [[PEPTIDOGLYCANSYN-PWY]] | ||
+ | * [[PWY-5265]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=10932}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=8142}} | |
− | + | {{#set: centisome position=35.35849 }} | |
− | + | {{#set: reaction associated=2.7.8.15-RXN|PHOSNACMURPENTATRANS-RXN|RXN-11347|RXN-8975}} | |
− | + | {{#set: pathway associated=PWY-6470|PWY-6471|MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS|PEPTIDOGLYCANSYN-PWY|PWY-5265}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:22, 21 March 2018
Gene Tiso_gene_1604
- right end position:
- 10932
- transcription direction:
- NEGATIVE
- left end position:
- 8142
- centisome position:
- 35.35849
- Synonym(s):
Reactions associated
- Reaction: 2.7.8.15-RXN
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Reaction: PHOSNACMURPENTATRANS-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: RXN-11347
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: RXN-8975
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation