Difference between revisions of "CPD-591"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_4990 == * left end position: ** 742 * transcription direction: ** POSITIVE * right end position: ** 2693 * centisome position: ** 5.2796354...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-591 CPD-591] == * smiles: ** C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_4990 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-591 CPD-591] ==
−
* left end position:
+
* smiles:
−
** 742
+
** C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)O)
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** cyanidin
−
* right end position:
+
* inchi key:
−
** 2693
+
** InChIKey=VEVZSMAEJFVWIL-UHFFFAOYSA-M
−
* centisome position:
+
* molecular weight:
−
** 5.2796354    
+
** 285.232    
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-1-Benzopyrylium
 +
** 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromenylium
 +
** 3,3',4',5,7-pentahydroxyflavylium
 +
** cyanidol
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[CATAL-RXN]]
+
* [[RXN-9725]]
−
** [[pantograph]]-[[synechocystis]]
+
== Reaction(s) known to produce the compound ==
−
* [[CYTOCHROME-C-PEROXIDASE-RXN]]
+
* [[RXN-602]]
−
** in-silico_annotation
+
== Reaction(s) of unknown directionality ==
−
***ec-number
+
−
** experimental_annotation
+
−
***ec-number
+
−
== Pathways associated ==
+
−
* [[PWY-5506]]
+
−
* [[DETOX1-PWY-1]]
+
−
* [[DETOX1-PWY]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=742}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202542 25202542]
−
{{#set: right end position=2693}}
+
* HMDB : HMDB02708
−
{{#set: centisome position=5.2796354   }}
+
* CHEBI:
−
{{#set: reaction associated=CATAL-RXN|CYTOCHROME-C-PEROXIDASE-RXN}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71682 71682]
−
{{#set: pathway associated=PWY-5506|DETOX1-PWY-1|DETOX1-PWY}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C05905 C05905]
 +
{{#set: smiles=C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)O)}}
 +
{{#set: common name=cyanidin}}
 +
{{#set: inchi key=InChIKey=VEVZSMAEJFVWIL-UHFFFAOYSA-M}}
 +
{{#set: molecular weight=285.232   }}
 +
{{#set: common name=2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-1-Benzopyrylium|2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromenylium|3,3',4',5,7-pentahydroxyflavylium|cyanidol}}
 +
{{#set: consumed by=RXN-9725}}
 +
{{#set: produced by=RXN-602}}

Latest revision as of 19:23, 21 March 2018

Metabolite CPD-591

  • smiles:
    • C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)O)
  • common name:
    • cyanidin
  • inchi key:
    • InChIKey=VEVZSMAEJFVWIL-UHFFFAOYSA-M
  • molecular weight:
    • 285.232
  • Synonym(s):
    • 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-1-Benzopyrylium
    • 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromenylium
    • 3,3',4',5,7-pentahydroxyflavylium
    • cyanidol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)O)" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-591&oldid=41251"