Difference between revisions of "RXN0-5265"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19157 CPD-19157] == * smiles: ** CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5265 RXN0-5265] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19157 CPD-19157] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5265 RXN0-5265] ==
* smiles:
+
* direction:
** CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=BEPLLRGJVXAEJI-TWAFKMGKSA-J
+
* common name:
+
** 3-oxo-(7Z)-tetradecenoyl-CoA
+
* molecular weight:
+
** 985.829   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-oxo-14:1-Δ7-CoA
 
** 3-oxo-7-cis-tetradecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-17795]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 4 [[PROTON]][c] '''+''' 4 [[E-]][c] '''=>''' 2 [[WATER]][c]
* [[RXN-17794]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
**
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: direction=LEFT-TO-RIGHT}}
{{#set: inchi key=InChIKey=BEPLLRGJVXAEJI-TWAFKMGKSA-J}}
+
{{#set: in pathway=}}
{{#set: common name=3-oxo-(7Z)-tetradecenoyl-CoA}}
+
{{#set: reconstruction category=annotation}}
{{#set: molecular weight=985.829    }}
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
{{#set: common name=3-oxo-14:1-Δ7-CoA|3-oxo-7-cis-tetradecenoyl-CoA}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: consumed by=RXN-17795}}
+
{{#set: produced by=RXN-17794}}
+

Latest revision as of 19:05, 21 March 2018

Reaction RXN0-5265

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

Reconstruction information

External links