Difference between revisions of "CPD0-2500"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.3.62-RXN 3.1.3.62-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.o...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2500 CPD0-2500] == * smiles: ** C(O)C2(C(O)C(O)C(O)C(OC1(C=CC(=CC=1)[N+]([O-])=O))O2) * co...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.3.62-RXN 3.1.3.62-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2500 CPD0-2500] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(O)C2(C(O)C(O)C(O)C(OC1(C=CC(=CC=1)[N+]([O-])=O))O2)
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/3.1.3.62 EC-3.1.3.62]
+
** p-nitrophenyl-α-D-galactopyranoside
 +
* inchi key:
 +
** InChIKey=IFBHRQDFSNCLOZ-IIRVCBMXSA-N
 +
* molecular weight:
 +
** 301.252   
 
* Synonym(s):
 
* Synonym(s):
 +
** 4-nitrophenyl-α-D-galactopyranoside
 +
** 4-nitrophenyl-α-D-galactoside
 +
** p-nitrophenyl-α-D-galactoside
 +
** pNPαGal
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-17830]]
−
** 1 [[WATER]][c] '''+''' 1 [[CPD-506]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[INOSITOL-1-4-5-TRISPHOSPHATE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H2O[c] '''+''' 1 D-myo-inositol (1,3,4,5)-tetrakisphosphate[c] '''=>''' 1 phosphate[c] '''+''' 1 D-myo-inositol (1,4,5)-trisphosphate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-6364]], D-myo-inositol (1,3,4)-trisphosphate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6364 PWY-6364]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R03434 R03434]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=82000 82000]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: ec number=EC-3.1.3.62}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=546840 546840]
−
{{#set: in pathway=PWY-6364}}
+
{{#set: smiles=C(O)C2(C(O)C(O)C(O)C(OC1(C=CC(=CC=1)[N+]([O-])=O))O2)}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: common name=p-nitrophenyl-α-D-galactopyranoside}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: inchi key=InChIKey=IFBHRQDFSNCLOZ-IIRVCBMXSA-N}}
−
{{#set: reconstruction source=in-silico_annotation}}
+
{{#set: molecular weight=301.252    }}
 +
{{#set: common name=4-nitrophenyl-α-D-galactopyranoside|4-nitrophenyl-α-D-galactoside|p-nitrophenyl-α-D-galactoside|pNPαGal}}
 +
{{#set: consumed by=RXN-17830}}

Latest revision as of 19:23, 21 March 2018

Metabolite CPD0-2500

  • smiles:
    • C(O)C2(C(O)C(O)C(O)C(OC1(C=CC(=CC=1)[N+]([O-])=O))O2)
  • common name:
    • p-nitrophenyl-α-D-galactopyranoside
  • inchi key:
    • InChIKey=IFBHRQDFSNCLOZ-IIRVCBMXSA-N
  • molecular weight:
    • 301.252
  • Synonym(s):
    • 4-nitrophenyl-α-D-galactopyranoside
    • 4-nitrophenyl-α-D-galactoside
    • p-nitrophenyl-α-D-galactoside
    • pNPαGal

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C2(C(O)C(O)C(O)C(OC1(C=CC(=CC=1)[N+]([O-])=O))O2)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD0-2500&oldid=41289"