Difference between revisions of "RXN-12776"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-591 CPD-591] == * smiles: ** C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12776 RXN-12776] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-591 CPD-591] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12776 RXN-12776] ==
−
* smiles:
+
* direction:
−
** C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=VEVZSMAEJFVWIL-UHFFFAOYSA-M
+
−
* common name:
+
−
** cyanidin
+
−
* molecular weight:
+
−
** 285.232   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-1-Benzopyrylium
 
−
** 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromenylium
 
−
** 3,3',4',5,7-pentahydroxyflavylium
 
−
** cyanidol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-9725]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[Donor-H2]][c] '''+''' 1.0 [[OLEATE-CPD]][c] '''+''' 1.0 [[OXYGEN-MOLECULE]][c] '''=>''' 1.0 [[Acceptor]][c] '''+''' 1.0 [[LINOLEIC_ACID]][c] '''+''' 2.0 [[WATER]][c]
−
* [[RXN-602]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1.0 a reduced electron acceptor[c] '''+''' 1.0 oleate[c] '''+''' 1.0 oxygen[c] '''=>''' 1.0 an oxidized electron acceptor[c] '''+''' 1.0 linoleate[c] '''+''' 2.0 H2O[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_9580]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_8027]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_18056]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_7427]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202542 25202542]
+
{{#set: gene associated=Tiso_gene_9580|Tiso_gene_8027|Tiso_gene_18056|Tiso_gene_7427}}
−
* CHEBI:
+
{{#set: in pathway=}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71682 71682]
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05905 C05905]
+
{{#set: reconstruction tool=pantograph}}
−
* HMDB : HMDB02708
+
−
{{#set: smiles=C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)O)}}
+
−
{{#set: inchi key=InChIKey=VEVZSMAEJFVWIL-UHFFFAOYSA-M}}
+
−
{{#set: common name=cyanidin}}
+
−
{{#set: molecular weight=285.232    }}
+
−
{{#set: common name=2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-1-Benzopyrylium|2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromenylium|3,3',4',5,7-pentahydroxyflavylium|cyanidol}}
+
−
{{#set: consumed by=RXN-9725}}
+
−
{{#set: produced by=RXN-602}}
+

Latest revision as of 19:23, 21 March 2018

Reaction RXN-12776

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 a reduced electron acceptor[c] + 1.0 oleate[c] + 1.0 oxygen[c] => 1.0 an oxidized electron acceptor[c] + 1.0 linoleate[c] + 2.0 H2O[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-12776&oldid=41298"