Difference between revisions of "PWY66-368"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3188 CPD-3188] == * smiles: ** C1(=O)(CC[CH](N(CO)1)C2(C=NC=CC=2)) * inchi key: ** InChIKey...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-368 PWY66-368] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7711 TAX-...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-368 PWY66-368] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7711 TAX-7711] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** ketolysis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** ketone body metabolism | ||
| + | ** ketone body degradation | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''3''' reactions found over '''3''' reactions in the full pathway | |
| − | * [[ | + | * [[3-HYDROXYBUTYRATE-DEHYDROGENASE-RXN]] |
| − | == Reaction(s) | + | ** 2 associated gene(s): |
| + | *** [[Tiso_gene_12472]] | ||
| + | *** [[Tiso_gene_7191]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-creinhardtii]] | ||
| + | * [[ACETYL-COA-ACETYLTRANSFER-RXN]] | ||
| + | ** 3 associated gene(s): | ||
| + | *** [[Tiso_gene_16181]] | ||
| + | *** [[Tiso_gene_15327]] | ||
| + | *** [[Tiso_gene_17451]] | ||
| + | ** 4 reconstruction source(s) associated: | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[orthology-creinhardtii]] | ||
| + | *** [[orthology-synechocystis]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[RXNI-2]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Tiso_gene_6754]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | * | + | * REACTOME : REACT_59 |
| − | + | {{#set: taxonomic range=TAX-7711}} | |
| − | + | {{#set: common name=ketolysis}} | |
| − | {{#set: | + | {{#set: common name=ketone body metabolism|ketone body degradation}} |
| − | {{#set: | + | {{#set: reaction found=3}} |
| − | {{#set: | + | {{#set: total reaction=3}} |
| − | {{#set: | + | {{#set: completion rate=100.0}} |
| − | {{#set: | + | |
Latest revision as of 19:23, 21 March 2018
Pathway PWY66-368
- taxonomic range:
- common name:
- ketolysis
- Synonym(s):
- ketone body metabolism
- ketone body degradation
Reaction(s) found
3 reactions found over 3 reactions in the full pathway
- 3-HYDROXYBUTYRATE-DEHYDROGENASE-RXN
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
- ACETYL-COA-ACETYLTRANSFER-RXN
- 3 associated gene(s):
- 4 reconstruction source(s) associated:
- RXNI-2
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
Reaction(s) not found
External links
- REACTOME : REACT_59
