Difference between revisions of "CPD-17263"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_17566 == * left end position: ** 23 * transcription direction: ** POSITIVE * right end position: ** 2739 * centisome position: ** 0.6369427...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17263 CPD-17263] == * smiles: ** CCC=CCC=CCC=CCC=CCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_17566 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17263 CPD-17263] ==
* left end position:
+
* smiles:
** 23
+
** CCC=CCC=CCC=CCC=CCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
* transcription direction:
+
* common name:
** POSITIVE
+
** (8Z,11Z,14Z,17Z)-3-hydroxy-icosa-8,11,14,17-tetraenoyl-CoA
* right end position:
+
* inchi key:
** 2739
+
** InChIKey=PCGPHLMAAZKQFQ-FPXDADDUSA-J
* centisome position:
+
* molecular weight:
** 0.6369427    
+
** 1065.958    
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-hydroxy-eicosatetraenoyl-CoA
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[GLUC1PURIDYLTRANS-RXN]]
+
== Reaction(s) known to produce the compound ==
** in-silico_annotation
+
* [[RXN-16020]]
***ec-number
+
== Reaction(s) of unknown directionality ==
** experimental_annotation
+
***ec-number
+
** [[pantograph]]-[[athaliana]]
+
** [[pantograph]]-[[esiliculosus]]
+
* [[UG1PUT]]
+
** [[pantograph]]-[[creinhardtii]]
+
* [[UTPHEXPURIDYLYLTRANS-RXN]]
+
** experimental_annotation
+
***automated-name-match
+
== Pathways associated ==
+
* [[PWY-7238]]
+
* [[PWY-7343]]
+
* [[PWY-3801]]
+
* [[PWY-3821]]
+
* [[PWY-7817]]
+
* [[PWY-6527]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=23}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819744 91819744]
{{#set: right end position=2739}}
+
{{#set: smiles=CCC=CCC=CCC=CCC=CCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: centisome position=0.6369427   }}
+
{{#set: common name=(8Z,11Z,14Z,17Z)-3-hydroxy-icosa-8,11,14,17-tetraenoyl-CoA}}
{{#set: reaction associated=GLUC1PURIDYLTRANS-RXN|UG1PUT|UTPHEXPURIDYLYLTRANS-RXN}}
+
{{#set: inchi key=InChIKey=PCGPHLMAAZKQFQ-FPXDADDUSA-J}}
{{#set: pathway associated=PWY-7238|PWY-7343|PWY-3801|PWY-3821|PWY-7817|PWY-6527}}
+
{{#set: molecular weight=1065.958   }}
 +
{{#set: common name=3-hydroxy-eicosatetraenoyl-CoA}}
 +
{{#set: produced by=RXN-16020}}

Latest revision as of 19:23, 21 March 2018

Metabolite CPD-17263

  • smiles:
    • CCC=CCC=CCC=CCC=CCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • common name:
    • (8Z,11Z,14Z,17Z)-3-hydroxy-icosa-8,11,14,17-tetraenoyl-CoA
  • inchi key:
    • InChIKey=PCGPHLMAAZKQFQ-FPXDADDUSA-J
  • molecular weight:
    • 1065.958
  • Synonym(s):
    • 3-hydroxy-eicosatetraenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC=CCC=CCC=CCC=CCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.