Difference between revisions of "RXN-9538"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12906 CPD-12906] == * smiles: ** CC(C)=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9538 RXN-9538] == * direction: ** LEFT-TO-RIGHT * common name: ** trans tetradec-2-enoyl-[acyl-...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12906 CPD-12906] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9538 RXN-9538] ==
−
* smiles:
+
* direction:
−
** CC(C)=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=ZFKZVSUJTDSJEY-SVHODSNWSA-J
+
 
* common name:
 
* common name:
−
** 5-methyl-3-oxo-4-hexenoyl-CoA
+
** trans tetradec-2-enoyl-[acyl-carrier-protein] reductase (NADPH, B-specific)
−
* molecular weight:
+
** polyketide_synthase
−
** 887.641   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.3.1.10 EC-1.3.1.10]
 +
** [http://enzyme.expasy.org/EC/1.3.1.39 EC-1.3.1.39]
 +
** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85]
 +
** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86]
 
* Synonym(s):
 
* Synonym(s):
 +
** trans tetradec-2-enoyl-[ACP] reductase
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-11921]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Tetradec-2-enoyl-ACPs]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[Myristoyl-ACPs]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 NADPH[c] '''+''' 1 H+[c] '''+''' 1 a trans tetradec-2-enoyl-[acp][c] '''=>''' 1 NADP+[c] '''+''' 1 a myristoyl-[acp][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_13394]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_10778]]
 +
** Source: [[orthology-synechocystis]]
 +
* Gene: [[Tiso_gene_10876]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_135]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_136]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_500]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994]
 +
** '''31''' reactions found over '''31''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[manual]]
 +
** Source: [[manual-primary_network]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986120 50986120]
+
{{#set: common name=trans tetradec-2-enoyl-[acyl-carrier-protein] reductase (NADPH, B-specific)}}
−
* LIGAND-CPD:
+
{{#set: common name=polyketide_synthase}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16471 C16471]
+
{{#set: ec number=EC-1.3.1.10}}
−
* HMDB : HMDB60399
+
{{#set: ec number=EC-1.3.1.39}}
−
{{#set: smiles=CC(C)=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: ec number=EC-2.3.1.85}}
−
{{#set: inchi key=InChIKey=ZFKZVSUJTDSJEY-SVHODSNWSA-J}}
+
{{#set: ec number=EC-2.3.1.86}}
−
{{#set: common name=5-methyl-3-oxo-4-hexenoyl-CoA}}
+
{{#set: common name=trans tetradec-2-enoyl-[ACP] reductase}}
−
{{#set: molecular weight=887.641    }}
+
{{#set: gene associated=Tiso_gene_13394|Tiso_gene_10778|Tiso_gene_10876|Tiso_gene_135|Tiso_gene_136|Tiso_gene_500}}
−
{{#set: consumed by=RXN-11921}}
+
{{#set: in pathway=PWY-5994}}
 +
{{#set: reconstruction category=orthology|manual|annotation}}
 +
{{#set: reconstruction source=manual-primary_network|annotation-in-silico_annotation|orthology-synechocystis}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 19:23, 21 March 2018

Reaction RXN-9538

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • trans tetradec-2-enoyl-[acyl-carrier-protein] reductase (NADPH, B-specific)
    • polyketide_synthase
  • ec number:
  • Synonym(s):
    • trans tetradec-2-enoyl-[ACP] reductase

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5994, palmitate biosynthesis I (animals and fungi): PWY-5994
    • 31 reactions found over 31 reactions in the full pathway

Reconstruction information

External links

"trans tetradec-2-enoyl-[acyl-carrier-protein] reductase (NADPH, B-specific)" cannot be used as a page name in this wiki.



"trans tetradec-2-enoyl-[ACP] reductase" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-9538&oldid=41339"