Difference between revisions of "PWY-7431"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17263 CPD-17263] == * smiles: ** CCC=CCC=CCC=CCC=CCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7431 PWY-7431] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17263 CPD-17263] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7431 PWY-7431] ==
* smiles:
+
* taxonomic range:
** CCC=CCC=CCC=CCC=CCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=PCGPHLMAAZKQFQ-FPXDADDUSA-J
+
 
* common name:
 
* common name:
** (8Z,11Z,14Z,17Z)-3-hydroxy-icosa-8,11,14,17-tetraenoyl-CoA
+
** aromatic biogenic amine degradation (bacteria)
* molecular weight:
+
** 1065.958   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-hydroxy-eicosatetraenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''8''' reactions in the full pathway
* [[RXN-16020]]
+
* [[RXN-5821]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_8756]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN6666-4]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_8756]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=1.2.1.53-RXN 1.2.1.53-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=OCTOPAMINE-DEHYDRATASE-RXN OCTOPAMINE-DEHYDRATASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15198 RXN-15198]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8505 RXN-8505]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN6666-5 RXN6666-5]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=SYNEPHRINE-DEHYDRATASE-RXN SYNEPHRINE-DEHYDRATASE-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819744 91819744]
+
{{#set: common name=aromatic biogenic amine degradation (bacteria)}}
{{#set: smiles=CCC=CCC=CCC=CCC=CCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction found=2}}
{{#set: inchi key=InChIKey=PCGPHLMAAZKQFQ-FPXDADDUSA-J}}
+
{{#set: total reaction=8}}
{{#set: common name=(8Z,11Z,14Z,17Z)-3-hydroxy-icosa-8,11,14,17-tetraenoyl-CoA}}
+
{{#set: completion rate=25.0}}
{{#set: molecular weight=1065.958    }}
+
{{#set: common name=3-hydroxy-eicosatetraenoyl-CoA}}
+
{{#set: produced by=RXN-16020}}
+

Latest revision as of 19:24, 21 March 2018

Pathway PWY-7431

  • taxonomic range:
  • common name:
    • aromatic biogenic amine degradation (bacteria)
  • Synonym(s):

Reaction(s) found

2 reactions found over 8 reactions in the full pathway

Reaction(s) not found

External links