Difference between revisions of "CPD-17050"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_20506 == * left end position: ** 16 * transcription direction: ** POSITIVE * right end position: ** 1147 * centisome position: ** 1.3029315...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17050 CPD-17050] == * smiles: ** C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3) * common name...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_20506 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17050 CPD-17050] ==
* left end position:
+
* smiles:
** 16
+
** C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3)
* transcription direction:
+
* common name:
** POSITIVE
+
** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine
* right end position:
+
* inchi key:
** 1147
+
** InChIKey=POIIJAAGMGNXLO-VXGBXAGGSA-N
* centisome position:
+
* molecular weight:
** 1.3029315    
+
** 296.358    
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-DKP
 +
** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)piperazine-2,5-dione
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** in-silico_annotation
+
* [[RXN-15684]]
***ec-number
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=16}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657891 90657891]
{{#set: right end position=1147}}
+
{{#set: smiles=C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3)}}
{{#set: centisome position=1.3029315   }}
+
{{#set: common name=3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine}}
{{#set: reaction associated=DNA-DIRECTED-RNA-POLYMERASE-RXN}}
+
{{#set: inchi key=InChIKey=POIIJAAGMGNXLO-VXGBXAGGSA-N}}
 +
{{#set: molecular weight=296.358   }}
 +
{{#set: common name=3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-DKP|3-benzyl-3,6 -disulfide-6-(hydroxymethyl)piperazine-2,5-dione}}
 +
{{#set: produced by=RXN-15684}}

Latest revision as of 19:24, 21 March 2018

Metabolite CPD-17050

  • smiles:
    • C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3)
  • common name:
    • 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine
  • inchi key:
    • InChIKey=POIIJAAGMGNXLO-VXGBXAGGSA-N
  • molecular weight:
    • 296.358
  • Synonym(s):
    • 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-DKP
    • 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)piperazine-2,5-dione

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links