Difference between revisions of "L-HISTIDINOL-P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYSTINE CYSTINE] == * smiles: ** C(C(C(=O)[O-])[N+])SSCC(C([O-])=O)[N+] * inchi key: ** InChIKe...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-HISTIDINOL-P L-HISTIDINOL-P] == * smiles: ** C1(NC=NC=1CC(COP([O-])(=O)[O-])[N+]) * common na...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-HISTIDINOL-P L-HISTIDINOL-P] == |
* smiles: | * smiles: | ||
− | ** | + | ** C1(NC=NC=1CC(COP([O-])(=O)[O-])[N+]) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** L- | + | ** L-histidinol-phosphate |
+ | * inchi key: | ||
+ | ** InChIKey=CWNDERHTHMWBSI-YFKPBYRVSA-M | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 220.144 |
* Synonym(s): | * Synonym(s): | ||
+ | ** histidinol-P | ||
+ | ** L-histidinol-p | ||
+ | ** histidinol-phosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[HISTIDPHOS-RXN]] |
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[HISTAMINOTRANS-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | * CAS : | + | * CAS : 25679-93-0 |
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791964 49791964] |
− | * | + | * KNAPSACK : C00007480 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01100 C01100] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57980 57980] |
− | * | + | * BIGG : hisp |
− | {{#set: smiles= | + | {{#set: smiles=C1(NC=NC=1CC(COP([O-])(=O)[O-])[N+])}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=L-histidinol-phosphate}} |
− | {{#set: common name=L- | + | {{#set: inchi key=InChIKey=CWNDERHTHMWBSI-YFKPBYRVSA-M}} |
− | {{#set: | + | {{#set: molecular weight=220.144 }} |
− | {{#set: | + | {{#set: common name=histidinol-P|L-histidinol-p|histidinol-phosphate}} |
+ | {{#set: consumed by=HISTIDPHOS-RXN}} | ||
+ | {{#set: produced by=HISTAMINOTRANS-RXN}} |
Latest revision as of 19:24, 21 March 2018
Contents
Metabolite L-HISTIDINOL-P
- smiles:
- C1(NC=NC=1CC(COP([O-])(=O)[O-])[N+])
- common name:
- L-histidinol-phosphate
- inchi key:
- InChIKey=CWNDERHTHMWBSI-YFKPBYRVSA-M
- molecular weight:
- 220.144
- Synonym(s):
- histidinol-P
- L-histidinol-p
- histidinol-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(NC=NC=1CC(COP([O-])(=O)[O-])[N+])" cannot be used as a page name in this wiki.