Difference between revisions of "RXN0-2381"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11770 CPD-11770] == * smiles: ** C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)CO)=2)) * inchi key: ** I...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2381 RXN0-2381] == * direction: ** REVERSIBLE * common name: ** tryptophan_synthase_(alpha_bet...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2381 RXN0-2381] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** tryptophan_synthase_(alpha_beta_chains) |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/4.1.2.8 EC-4.1.2.8] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1 [[INDOLE-3-GLYCEROL-P]][c] '''<=>''' 1 [[INDOLE]][c] '''+''' 1 [[GAP]][c] |
− | * [[ | + | * With common name(s): |
+ | ** 1 (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate[c] '''<=>''' 1 indole[c] '''+''' 1 D-glyceraldehyde 3-phosphate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_17207]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_4604]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[TRPSYN-PWY]], L-tryptophan biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=TRPSYN-PWY TRPSYN-PWY] | ||
+ | ** '''6''' reactions found over '''6''' reactions in the full pathway | ||
+ | * [[PWY-6949]], DIBOA-glucoside biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6949 PWY-6949] | ||
+ | ** '''1''' reactions found over '''6''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14081 14081] | |
− | + | * LIGAND-RXN: | |
− | ** [http://www.ebi.ac.uk/ | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02340 R02340] |
− | * | + | {{#set: direction=REVERSIBLE}} |
− | ** [http:// | + | {{#set: common name=tryptophan_synthase_(alpha_beta_chains)}} |
− | {{#set: | + | {{#set: ec number=EC-4.1.2.8}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_17207|Tiso_gene_4604}} |
− | {{#set: | + | {{#set: in pathway=TRPSYN-PWY|PWY-6949}} |
− | {{#set: | + | {{#set: reconstruction category=orthology|annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation|orthology-esiliculosus}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 19:25, 21 March 2018
Contents
Reaction RXN0-2381
- direction:
- REVERSIBLE
- common name:
- tryptophan_synthase_(alpha_beta_chains)
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 INDOLE-3-GLYCEROL-P[c] <=> 1 INDOLE[c] + 1 GAP[c]
- With common name(s):
- 1 (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate[c] <=> 1 indole[c] + 1 D-glyceraldehyde 3-phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_17207
- Source: orthology-esiliculosus
- Gene: Tiso_gene_4604
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
Pathways
- TRPSYN-PWY, L-tryptophan biosynthesis: TRPSYN-PWY
- 6 reactions found over 6 reactions in the full pathway
- PWY-6949, DIBOA-glucoside biosynthesis: PWY-6949
- 1 reactions found over 6 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
External links