Difference between revisions of "CPD-14425"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_10066 == * left end position: ** 496 * transcription direction: ** POSITIVE * right end position: ** 1714 * centisome position: ** 2.521478...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14425 CPD-14425] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14425 CPD-14425] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCC=CCC=CCC=CCC=CCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| − | * | + | * common name: |
| − | ** | + | ** (2E,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl-CoA |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=HGVXUTAEZALTIG-HKHRKLHHSA-J |
| − | * | + | * molecular weight: |
| − | ** | + | ** 1073.981 |
* Synonym(s): | * Synonym(s): | ||
| + | ** docosapentaenoyl-2-enoyl-CoA | ||
| + | ** (2E,7Z,10Z,13Z,16Z,19Z)-docosa-2,7,10,13,16,19-hexaenoyl-CoA | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-13445]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-13444]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72551532 72551532] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76461 76461] |
| − | {{#set: | + | {{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: | + | {{#set: common name=(2E,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl-CoA}} |
| + | {{#set: inchi key=InChIKey=HGVXUTAEZALTIG-HKHRKLHHSA-J}} | ||
| + | {{#set: molecular weight=1073.981 }} | ||
| + | {{#set: common name=docosapentaenoyl-2-enoyl-CoA|(2E,7Z,10Z,13Z,16Z,19Z)-docosa-2,7,10,13,16,19-hexaenoyl-CoA}} | ||
| + | {{#set: consumed by=RXN-13445}} | ||
| + | {{#set: produced by=RXN-13444}} | ||
Latest revision as of 19:25, 21 March 2018
Contents
Metabolite CPD-14425
- smiles:
- CCC=CCC=CCC=CCC=CCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- (2E,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl-CoA
- inchi key:
- InChIKey=HGVXUTAEZALTIG-HKHRKLHHSA-J
- molecular weight:
- 1073.981
- Synonym(s):
- docosapentaenoyl-2-enoyl-CoA
- (2E,7Z,10Z,13Z,16Z,19Z)-docosa-2,7,10,13,16,19-hexaenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC=CCC=CCC=CCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
