Difference between revisions of "CPD-15172"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN] == * direction: ** LEFT-...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15172 CPD-15172] == * smiles: ** C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3))) * co...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15172 CPD-15172] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3)))
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/3.2.2.16 EC-3.2.2.16]
+
** 6,7-dehydrobaicalein
 +
* inchi key:
 +
** InChIKey=LSQWCIYRGVWPFX-UHFFFAOYSA-N
 +
* molecular weight:
 +
** 268.225   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[5-METHYLTHIOADENOSINE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-560]][c] '''+''' 1 [[ADENINE]][c]
+
* [[RXN-14240]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 S-methyl-5'-thioadenosine[c] '''+''' 1 H2O[c] '''=>''' 1 S-methyl-5-thio-D-ribose[c] '''+''' 1 adenine[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_12855]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
* [[PWY0-1391]], S-methyl-5'-thioadenosine degradation IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1391 PWY0-1391]
+
−
** '''1''' reactions found over '''1''' reactions in the full pathway
+
−
* [[PWY-6754]], S-methyl-5'-thioadenosine degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6754 PWY-6754]
+
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13617 13617]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86200952 86200952]
−
* LIGAND-RXN:
+
{{#set: smiles=C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3)))}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R01401 R01401]
+
{{#set: common name=6,7-dehydrobaicalein}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: inchi key=InChIKey=LSQWCIYRGVWPFX-UHFFFAOYSA-N}}
−
{{#set: ec number=EC-3.2.2.16}}
+
{{#set: molecular weight=268.225    }}
−
{{#set: gene associated=Tiso_gene_12855}}
+
{{#set: produced by=RXN-14240}}
−
{{#set: in pathway=PWY0-1391|PWY-6754}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=creinhardtii}}
+

Latest revision as of 19:25, 21 March 2018

Metabolite CPD-15172

  • smiles:
    • C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3)))
  • common name:
    • 6,7-dehydrobaicalein
  • inchi key:
    • InChIKey=LSQWCIYRGVWPFX-UHFFFAOYSA-N
  • molecular weight:
    • 268.225
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-15172&oldid=41492"