Difference between revisions of "CPD-323"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE] == * smiles: ** C(NC1(NC...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-323 CPD-323] == * smiles: ** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-323 CPD-323] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34)))) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** cholest-4-en-3-one |
+ | * inchi key: | ||
+ | ** InChIKey=NYOXRYYXRWJDKP-GYKMGIIDSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 384.644 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** cholestenone |
− | ** | + | ** 4-cholesten-3-one |
− | + | ** 4-cholestene-3-one | |
− | + | ||
− | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[CHOLESTENONE-5-ALPHA-REDUCTASE-RXN]] | ||
== External links == | == External links == | ||
+ | * CAS : 601-57-0 | ||
+ | * LIPID_MAPS : LMST01010015 | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91477 91477] | ||
+ | * HMDB : HMDB00921 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00599 C00599] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.82602.html 82602] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16175 16175] |
− | + | {{#set: smiles=CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))}} | |
− | + | {{#set: common name=cholest-4-en-3-one}} | |
− | + | {{#set: inchi key=InChIKey=NYOXRYYXRWJDKP-GYKMGIIDSA-N}} | |
− | + | {{#set: molecular weight=384.644 }} | |
− | {{#set: smiles=C( | + | {{#set: common name=cholestenone|4-cholesten-3-one|4-cholestene-3-one}} |
− | {{#set: | + | {{#set: reversible reaction associated=CHOLESTENONE-5-ALPHA-REDUCTASE-RXN}} |
− | {{#set: | + | |
− | {{#set: molecular weight= | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:25, 21 March 2018
Contents
Metabolite CPD-323
- smiles:
- CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))
- common name:
- cholest-4-en-3-one
- inchi key:
- InChIKey=NYOXRYYXRWJDKP-GYKMGIIDSA-N
- molecular weight:
- 384.644
- Synonym(s):
- cholestenone
- 4-cholesten-3-one
- 4-cholestene-3-one
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 601-57-0
- LIPID_MAPS : LMST01010015
- PUBCHEM:
- HMDB : HMDB00921
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
"CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.