Difference between revisions of "TCM3"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14425 CPD-14425] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TCM3 TCM3] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With identifiers:...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14425 CPD-14425] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TCM3 TCM3] ==
−
* smiles:
+
* direction:
−
** CCC=CCC=CCC=CCC=CCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=HGVXUTAEZALTIG-HKHRKLHHSA-J
+
−
* common name:
+
−
** (2E,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl-CoA
+
−
* molecular weight:
+
−
** 1073.981   
+
 
* Synonym(s):
 
* Synonym(s):
−
** docosapentaenoyl-2-enoyl-CoA
 
−
** (2E,7Z,10Z,13Z,16Z,19Z)-docosa-2,7,10,13,16,19-hexaenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-13445]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[PPI]][c] '''<=>''' 1.0 [[PPI]][m]
−
* [[RXN-13444]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1.0 diphosphate[c] '''<=>''' 1.0 diphosphate[m]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_7472]]
 +
** Source: [[orthology-athaliana]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72551532 72551532]
+
{{#set: gene associated=Tiso_gene_7472}}
−
* CHEBI:
+
{{#set: in pathway=}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76461 76461]
+
{{#set: reconstruction category=orthology}}
−
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reconstruction source=orthology-athaliana}}
−
{{#set: inchi key=InChIKey=HGVXUTAEZALTIG-HKHRKLHHSA-J}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: common name=(2E,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl-CoA}}
+
−
{{#set: molecular weight=1073.981    }}
+
−
{{#set: common name=docosapentaenoyl-2-enoyl-CoA|(2E,7Z,10Z,13Z,16Z,19Z)-docosa-2,7,10,13,16,19-hexaenoyl-CoA}}
+
−
{{#set: consumed by=RXN-13445}}
+
−
{{#set: produced by=RXN-13444}}
+

Latest revision as of 19:25, 21 March 2018

Reaction TCM3

  • direction:
    • REVERSIBLE
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 diphosphate[c] <=> 1.0 diphosphate[m]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=TCM3&oldid=41527"