Difference between revisions of "RXN-6382"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1063 CPD-1063] == * smiles: ** CSCC(O)C(O)C(=O)COP([O-])(=O)[O-] * inchi key: ** InChIKey=C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6382 RXN-6382] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1063 CPD-1063] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6382 RXN-6382] ==
−
* smiles:
+
* direction:
−
** CSCC(O)C(O)C(=O)COP([O-])(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=CNSJRYUMVMWNMC-RITPCOANSA-L
+
** [http://enzyme.expasy.org/EC/1.2.1 EC-1.2.1]
−
* common name:
+
−
** 5-methylthioribulose 1-phosphate
+
−
* molecular weight:
+
−
** 258.182   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 5-methylthio-5-deoxy-D-ribulose 1-phosphate
 
−
** 1-phosphomethylthioribulose
 
−
** methylthioribulose 1-phosphate
 
−
** MTRu-1-P
 
−
** 1PMT-ribulose
 
−
** 1-phospho-5-S-methylthioribulose
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[M5TRPI]]
+
** 1 [[NAD-P-OR-NOP]][c] '''+''' 1 [[CPD-6082]][c] '''+''' 1 [[WATER]][c] '''=>''' 2 [[PROTON]][c] '''+''' 1 [[B-ALANINE]][c] '''+''' 1 [[NADH-P-OR-NOP]][c]
−
* [[5.3.1.23-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 NAD(P)+[c] '''+''' 1 3-aminopropanal[c] '''+''' 1 H2O[c] '''=>''' 2 H+[c] '''+''' 1 β-alanine[c] '''+''' 1 NAD(P)H[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_3513]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_7322]]
 +
** Source: [[orthology-athaliana]]
 +
== Pathways  ==
 +
* [[PWY-3981]], β-alanine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3981 PWY-3981]
 +
** '''2''' reactions found over '''2''' reactions in the full pathway
 +
* [[PWY-5760]], β-alanine biosynthesis IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5760 PWY-5760]
 +
** '''1''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* METABOLIGHTS : MTBLC58548
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: ec number=EC-1.2.1}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615271 23615271]
+
{{#set: gene associated=Tiso_gene_3513|Tiso_gene_7322}}
−
* HMDB : HMDB01299
+
{{#set: in pathway=PWY-3981|PWY-5760}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04582 C04582]
+
{{#set: reconstruction source=orthology-athaliana|orthology-creinhardtii}}
−
* CHEMSPIDER:
+
{{#set: reconstruction tool=pantograph}}
−
** [http://www.chemspider.com/Chemical-Structure.19951215.html 19951215]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58548 58548]
+
−
* BIGG : 5mdru1p
+
−
{{#set: smiles=CSCC(O)C(O)C(=O)COP([O-])(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=CNSJRYUMVMWNMC-RITPCOANSA-L}}
+
−
{{#set: common name=5-methylthioribulose 1-phosphate}}
+
−
{{#set: molecular weight=258.182    }}
+
−
{{#set: common name=5-methylthio-5-deoxy-D-ribulose 1-phosphate|1-phosphomethylthioribulose|methylthioribulose 1-phosphate|MTRu-1-P|1PMT-ribulose|1-phospho-5-S-methylthioribulose}}
+
−
{{#set: produced by=M5TRPI|5.3.1.23-RXN}}
+

Latest revision as of 19:26, 21 March 2018

Reaction RXN-6382

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-3981, β-alanine biosynthesis I: PWY-3981
    • 2 reactions found over 2 reactions in the full pathway
  • PWY-5760, β-alanine biosynthesis IV: PWY-5760
    • 1 reactions found over 2 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-6382&oldid=41579"