Difference between revisions of "CPDQT-41"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_5305 == * left end position: ** 5038 * transcription direction: ** NEGATIVE * right end position: ** 7253 * centisome position: ** 36.85442...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-41 CPDQT-41] == * smiles: ** CSCCCCCCCCC(=O)C([O-])=O * common name: ** 10-(methylthio)-2...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_5305 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-41 CPDQT-41] ==
* left end position:
+
* smiles:
** 5038
+
** CSCCCCCCCCC(=O)C([O-])=O
* transcription direction:
+
* common name:
** NEGATIVE
+
** 10-(methylthio)-2-oxodecanoate
* right end position:
+
* inchi key:
** 7253
+
** InChIKey=IEZWLIJBCDCGEU-UHFFFAOYSA-M
* centisome position:
+
* molecular weight:
** 36.854424    
+
** 231.329    
 
* Synonym(s):
 
* Synonym(s):
 +
** 10-(methylthio)-2-oxo-decanoic acid
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[3.1.3.16-RXN]]
+
== Reaction(s) known to produce the compound ==
** in-silico_annotation
+
* [[RXN-18201]]
***automated-name-match
+
* [[RXNQT-4178]]
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: left end position=5038}}
+
* PUBCHEM:
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237295 44237295]
{{#set: right end position=7253}}
+
* KNAPSACK : C00007651
{{#set: centisome position=36.854424   }}
+
{{#set: smiles=CSCCCCCCCCC(=O)C([O-])=O}}
{{#set: reaction associated=3.1.3.16-RXN}}
+
{{#set: common name=10-(methylthio)-2-oxodecanoate}}
 +
{{#set: inchi key=InChIKey=IEZWLIJBCDCGEU-UHFFFAOYSA-M}}
 +
{{#set: molecular weight=231.329   }}
 +
{{#set: common name=10-(methylthio)-2-oxo-decanoic acid}}
 +
{{#set: produced by=RXN-18201|RXNQT-4178}}

Latest revision as of 19:26, 21 March 2018

Metabolite CPDQT-41

  • smiles:
    • CSCCCCCCCCC(=O)C([O-])=O
  • common name:
    • 10-(methylthio)-2-oxodecanoate
  • inchi key:
    • InChIKey=IEZWLIJBCDCGEU-UHFFFAOYSA-M
  • molecular weight:
    • 231.329
  • Synonym(s):
    • 10-(methylthio)-2-oxo-decanoic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • PUBCHEM:
  • KNAPSACK : C00007651
"CSCCCCCCCCC(=O)C([O-])=O" cannot be used as a page name in this wiki.