Difference between revisions of "CPD-17262"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_18526 == * Synonym(s): == Reactions associated == * 1.5.5.1-RXN ** pantograph-esiliculosus == Pathways associated == == Extern...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17262 CPD-17262] == * smiles: ** CCC=CCC=CCC=CCC=CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17262 CPD-17262] == |
+ | * smiles: | ||
+ | ** CCC=CCC=CCC=CCC=CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
+ | * common name: | ||
+ | ** 3-oxo-icosatetraenoyl-CoA | ||
+ | * inchi key: | ||
+ | ** InChIKey=VVLBCJHQULSXJN-QWOXCLFSSA-J | ||
+ | * molecular weight: | ||
+ | ** 1063.942 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** (8Z,11Z,14Z,17Z)-3-oxo-icosa-8,11,14,17-tetraenoyl-CoA | ||
+ | ** 3-oxo-eicosatetraenoyl-CoA | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-16020]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70698357 70698357] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71491 71491] | ||
+ | {{#set: smiles=CCC=CCC=CCC=CCC=CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
+ | {{#set: common name=3-oxo-icosatetraenoyl-CoA}} | ||
+ | {{#set: inchi key=InChIKey=VVLBCJHQULSXJN-QWOXCLFSSA-J}} | ||
+ | {{#set: molecular weight=1063.942 }} | ||
+ | {{#set: common name=(8Z,11Z,14Z,17Z)-3-oxo-icosa-8,11,14,17-tetraenoyl-CoA|3-oxo-eicosatetraenoyl-CoA}} | ||
+ | {{#set: consumed by=RXN-16020}} |
Latest revision as of 20:26, 21 March 2018
Contents
Metabolite CPD-17262
- smiles:
- CCC=CCC=CCC=CCC=CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- 3-oxo-icosatetraenoyl-CoA
- inchi key:
- InChIKey=VVLBCJHQULSXJN-QWOXCLFSSA-J
- molecular weight:
- 1063.942
- Synonym(s):
- (8Z,11Z,14Z,17Z)-3-oxo-icosa-8,11,14,17-tetraenoyl-CoA
- 3-oxo-eicosatetraenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC=CCC=CCC=CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.