Difference between revisions of "Tiso gene 19198"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10413 CPD-10413] == * smiles: ** C1(=C(C=CC(O)=C1)C2(C(O)CC3(C(O2)=CC(O)=CC(O)=3))) * inchi...") |
(Created page with "Category:Gene == Gene Tiso_gene_19198 == * right end position: ** 2382 * transcription direction: ** NEGATIVE * left end position: ** 97 * centisome position: ** 3.846154...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_19198 == |
− | * | + | * right end position: |
− | ** | + | ** 2382 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 97 |
− | * | + | * centisome position: |
− | ** | + | ** 3.846154 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[UDPNACETYLGLUCOSAMACYLTRANS-RXN]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: ec-number |
+ | ** Source: [[orthology-synechocystis]] | ||
+ | == Pathways associated == | ||
+ | * [[NAGLIPASYN-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=2382}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=97}} | |
− | + | {{#set: centisome position=3.846154 }} | |
− | + | {{#set: reaction associated=UDPNACETYLGLUCOSAMACYLTRANS-RXN}} | |
− | + | {{#set: pathway associated=NAGLIPASYN-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:27, 21 March 2018
Gene Tiso_gene_19198
- right end position:
- 2382
- transcription direction:
- NEGATIVE
- left end position:
- 97
- centisome position:
- 3.846154
- Synonym(s):
Reactions associated
- Reaction: UDPNACETYLGLUCOSAMACYLTRANS-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-synechocystis
- Source: annotation-in-silico_annotation