Difference between revisions of "CPD-14927"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_12989 == * left end position: ** 18 * transcription direction: ** POSITIVE * right end position: ** 4670 * centisome position: ** 0.1716083...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14927 CPD-14927] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-] * common name: ** ph...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14927 CPD-14927] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-] |
| − | * | + | * common name: |
| − | ** | + | ** phytenate |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=WDWBNNBRPVEEOD-PFXVRADUSA-M |
| − | * | + | * molecular weight: |
| − | ** | + | ** 309.511 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 2E-phytenate | ||
| + | ** 2E-phytenic acid | ||
| + | ** 3,7,11,15-tetramethyl-2E-hexadecenoic acid | ||
| + | ** (E)-3,7,11,15-tetramethylhexadec-2-enoic acid | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN66-480]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN66-479]] |
| − | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
| − | {{#set: | + | * LIPID_MAPS : LMPR0104010024 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=40561589 40561589] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.4471755.html 4471755] |
| + | {{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-]}} | ||
| + | {{#set: common name=phytenate}} | ||
| + | {{#set: inchi key=InChIKey=WDWBNNBRPVEEOD-PFXVRADUSA-M}} | ||
| + | {{#set: molecular weight=309.511 }} | ||
| + | {{#set: common name=2E-phytenate|2E-phytenic acid|3,7,11,15-tetramethyl-2E-hexadecenoic acid|(E)-3,7,11,15-tetramethylhexadec-2-enoic acid}} | ||
| + | {{#set: consumed by=RXN66-480}} | ||
| + | {{#set: produced by=RXN66-479}} | ||
Latest revision as of 19:28, 21 March 2018
Contents
Metabolite CPD-14927
- smiles:
- CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-]
- common name:
- phytenate
- inchi key:
- InChIKey=WDWBNNBRPVEEOD-PFXVRADUSA-M
- molecular weight:
- 309.511
- Synonym(s):
- 2E-phytenate
- 2E-phytenic acid
- 3,7,11,15-tetramethyl-2E-hexadecenoic acid
- (E)-3,7,11,15-tetramethylhexadec-2-enoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-" cannot be used as a page name in this wiki.
