Difference between revisions of "PWY-7394"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CREATINE CREATINE] == * smiles: ** C(C(=O)[O-])N(C)C(N)=[N+] * inchi key: ** InChIKey=CVSVTCORW...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7394 PWY-7394] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CREATINE CREATINE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7394 PWY-7394] ==
* smiles:
+
* taxonomic range:
** C(C(=O)[O-])N(C)C(N)=[N+]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=CVSVTCORWBXHQV-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** creatine
+
** urate degradation to allantoin II
* molecular weight:
+
** 131.134   
+
 
* Synonym(s):
 
* Synonym(s):
** methylguanidinoacetic acid
 
** N-amidinosarcosine
 
** methylglycocyamine
 
** N-methyl-N-guanylglycine
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[CREATINASE-RXN]]
+
'''2''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[3.5.2.17-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_13181]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-creinhardtii]]
 +
* [[RXN-6201]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11186 RXN-11186]
 
== External links  ==
 
== External links  ==
* CAS : 57-00-1
+
{{#set: taxonomic range=TAX-2}}
* PUBCHEM:
+
{{#set: common name=urate degradation to allantoin II}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7058172 7058172]
+
{{#set: reaction found=2}}
* HMDB : HMDB00064
+
{{#set: total reaction=3}}
* LIGAND-CPD:
+
{{#set: completion rate=67.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C00300 C00300]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.5414502.html 5414502]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57947 57947]
+
* METABOLIGHTS : MTBLC57947
+
{{#set: smiles=C(C(=O)[O-])N(C)C(N)=[N+]}}
+
{{#set: inchi key=InChIKey=CVSVTCORWBXHQV-UHFFFAOYSA-N}}
+
{{#set: common name=creatine}}
+
{{#set: molecular weight=131.134    }}
+
{{#set: common name=methylguanidinoacetic acid|N-amidinosarcosine|methylglycocyamine|N-methyl-N-guanylglycine}}
+
{{#set: consumed by=CREATINASE-RXN}}
+

Latest revision as of 20:28, 21 March 2018

Pathway PWY-7394

  • taxonomic range:
  • common name:
    • urate degradation to allantoin II
  • Synonym(s):

Reaction(s) found

2 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links