Difference between revisions of "PWY-6949"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7367 CPD-7367] == * smiles: ** [CH](=O)C1(=CC=C(O)C(N)=C1) * inchi key: ** InChIKey=LMGGPKY...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6949 PWY-6949] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-33...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6949 PWY-6949] == |
| − | * | + | * taxonomic range: |
| − | ** [ | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-3398] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** DIBOA-glucoside biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** DIBOA biosynthesis | ||
| + | ** DIBOA-Glc biosynthesis | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''6''' reactions in the full pathway | |
| − | == Reaction(s) | + | * [[RXN0-2381]] |
| − | * [[RXN- | + | ** 2 associated gene(s): |
| + | *** [[Tiso_gene_17207]] | ||
| + | *** [[Tiso_gene_4604]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-6681 RXN-6681] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-6682 RXN-6682] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-6683 RXN-6683] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-6684 RXN-6684] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-7021 RXN-7021] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-3398}} | |
| − | + | {{#set: common name=DIBOA-glucoside biosynthesis}} | |
| − | + | {{#set: common name=DIBOA biosynthesis|DIBOA-Glc biosynthesis}} | |
| − | + | {{#set: reaction found=1}} | |
| − | {{#set: | + | {{#set: total reaction=6}} |
| − | {{#set: | + | {{#set: completion rate=17.0}} |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:28, 21 March 2018
Pathway PWY-6949
- taxonomic range:
- common name:
- DIBOA-glucoside biosynthesis
- Synonym(s):
- DIBOA biosynthesis
- DIBOA-Glc biosynthesis
Reaction(s) found
1 reactions found over 6 reactions in the full pathway
- RXN0-2381
- 2 associated gene(s):
- 3 reconstruction source(s) associated:
