Difference between revisions of "PWY-6339"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRP TRP] == * smiles: ** C2(NC1(C=CC=CC=1C(CC([N+])C(=O)[O-])=2)) * inchi key: ** InChIKey=QIVB...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6339 PWY-6339] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6339 PWY-6339] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** syringate degradation |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''1''' reactions found over '''11''' reactions in the full pathway |
− | * [[ | + | * [[OXALODECARB-RXN]] |
− | * [[ | + | ** 2 associated gene(s): |
− | == Reaction(s) | + | *** [[Tiso_gene_12200]] |
− | * [[ | + | *** [[Tiso_gene_12896]] |
− | * [[ | + | ** 1 reconstruction source(s) associated: |
− | * [ | + | *** [[orthology-esiliculosus]] |
− | = | + | == Reaction(s) not found == |
+ | * [http://metacyc.org/META/NEW-IMAGE?object=GALLATE-DEGRADATION-II-PWY GALLATE-DEGRADATION-II-PWY] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=GALLATE-DEGRADATION-II-PWY GALLATE-DEGRADATION-II-PWY] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=METHYLGALLATE-RXN METHYLGALLATE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-10889 RXN-10889] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-10890 RXN-10890] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-10892 RXN-10892] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-10893 RXN-10893] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13747 RXN-13747] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-2462 RXN-2462] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9983 RXN-9983] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=syringate degradation}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=11}} | |
− | + | {{#set: completion rate=9.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:28, 21 March 2018
Pathway PWY-6339
- taxonomic range:
- common name:
- syringate degradation
- Synonym(s):
Reaction(s) found
1 reactions found over 11 reactions in the full pathway
- OXALODECARB-RXN
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
- GALLATE-DEGRADATION-II-PWY
- GALLATE-DEGRADATION-II-PWY
- METHYLGALLATE-RXN
- RXN-10889
- RXN-10890
- RXN-10892
- RXN-10893
- RXN-13747
- RXN-2462
- RXN-9983