Difference between revisions of "PWY-5283"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-714 CPD-714] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5283 PWY-5283] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-714 CPD-714] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5283 PWY-5283] ==
* smiles:
+
* taxonomic range:
** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=JSVPGVHCEQDJCZ-VGEHDTSWSA-N
+
 
* common name:
 
* common name:
** cathasterone
+
** L-lysine degradation V
* molecular weight:
+
** 432.685   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-aminoadipate pathway
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-716]]
+
'''2''' reactions found over '''9''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[2-AMINOADIPATE-AMINOTRANSFERASE-RXN]]
* [[RXN-715]]
+
** 0 associated gene:
== Reaction(s) of unknown directionality ==
+
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-8162]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_6563]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=L-PIPECOLATE-OXIDASE-RXN L-PIPECOLATE-OXIDASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=LYSINE-RACEMASE-RXN LYSINE-RACEMASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14724 RXN-14724]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8163 RXN-8163]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8166 RXN-8166]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8167 RXN-8167]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8172 RXN-8172]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15341086 15341086]
+
{{#set: common name=L-lysine degradation V}}
* CHEBI:
+
{{#set: common name=2-aminoadipate pathway}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=23057 23057]
+
{{#set: reaction found=2}}
* LIGAND-CPD:
+
{{#set: total reaction=9}}
** [http://www.genome.jp/dbget-bin/www_bget?C15790 C15790]
+
{{#set: completion rate=22.0}}
{{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=JSVPGVHCEQDJCZ-VGEHDTSWSA-N}}
+
{{#set: common name=cathasterone}}
+
{{#set: molecular weight=432.685    }}
+
{{#set: consumed by=RXN-716}}
+
{{#set: produced by=RXN-715}}
+

Latest revision as of 20:15, 21 March 2018

Pathway PWY-5283

  • taxonomic range:
  • common name:
    • L-lysine degradation V
  • Synonym(s):
    • 2-aminoadipate pathway

Reaction(s) found

2 reactions found over 9 reactions in the full pathway

Reaction(s) not found

External links