Difference between revisions of "ACECOATRANS-RXN-CPD-14717/ACET//R-2-HYDROXYSTEARATE/ACETYL-COA.47."
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAQUINONE DOPAQUINONE] == * smiles: ** C([O-])(=O)C([N+])CC1(=CC(=O)C(=O)C=C1) * inchi key: *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACECOATRANS-RXN-CPD-14717/ACET//R-2-HYDROXYSTEARATE/ACETYL-COA.47. ACECOATRANS-RXN-CPD-14717/ACET//...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACECOATRANS-RXN-CPD-14717/ACET//R-2-HYDROXYSTEARATE/ACETYL-COA.47. ACECOATRANS-RXN-CPD-14717/ACET//R-2-HYDROXYSTEARATE/ACETYL-COA.47.] == |
− | + | * direction: | |
− | + | ** REVERSIBLE | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1.0 [[ACET]][c] '''+''' 1.0 [[CPD-14717]][c] '''<=>''' 1.0 [[R-2-HYDROXYSTEARATE]][c] '''+''' 1.0 [[ACETYL-COA]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1.0 acetate[c] '''+''' 1.0 (R)-2-hydroxy-stearoyl-CoA[c] '''<=>''' 1.0 (R)-2-hydroxystearate[c] '''+''' 1.0 acetyl-CoA[c] |
− | * [[ | + | |
− | + | == Genes associated with this reaction == | |
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[gap-filling]] | ||
+ | ** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
+ | *** Tool: [[meneco]] | ||
+ | **** Comment: [[added for gapfilling]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=gap-filling}} | |
− | + | {{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}} | |
− | + | {{#set: reconstruction tool=meneco}} | |
− | + | {{#set: reconstruction comment=added for gapfilling}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:29, 21 March 2018
Contents
Reaction ACECOATRANS-RXN-CPD-14717/ACET//R-2-HYDROXYSTEARATE/ACETYL-COA.47.
- direction:
- REVERSIBLE
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 ACET[c] + 1.0 CPD-14717[c] <=> 1.0 R-2-HYDROXYSTEARATE[c] + 1.0 ACETYL-COA[c]
- With common name(s):
- 1.0 acetate[c] + 1.0 (R)-2-hydroxy-stearoyl-CoA[c] <=> 1.0 (R)-2-hydroxystearate[c] + 1.0 acetyl-CoA[c]
Genes associated with this reaction
Pathways
Reconstruction information
- Category: gap-filling
- Source: gap-filling-gapfilling_solution_with_meneco_draft_medium
- Tool: meneco
- Comment: added for gapfilling
- Tool: meneco
- Source: gap-filling-gapfilling_solution_with_meneco_draft_medium