Difference between revisions of "CHLOROPHYLLIDE-A"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_9873 == * Synonym(s): == Reactions associated == * 1.14.11.2-RXN ** pantograph-esiliculosus * RXN490-3641 ** [[pantograph]...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLLIDE-A CHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLLIDE-A CHLOROPHYLLIDE-A] == |
| + | * smiles: | ||
| + | ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9)))) | ||
| + | * common name: | ||
| + | ** chlorophyllide a | ||
| + | * molecular weight: | ||
| + | ** 612.967 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** chlorophyllide | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-7663]] |
| − | + | * [[RXN-7676]] | |
| − | * [[ | + | * [[RXN-13398]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-5286]] | |
| + | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN1F-10]] | ||
| + | * [[RXN1F-66]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 14897-06-4 |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54729368 54729368] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83348 83348] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C02139 C02139] | ||
| + | {{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}} | ||
| + | {{#set: common name=chlorophyllide a}} | ||
| + | {{#set: molecular weight=612.967 }} | ||
| + | {{#set: common name=chlorophyllide}} | ||
| + | {{#set: consumed by=RXN-7663|RXN-7676|RXN-13398}} | ||
| + | {{#set: produced by=RXN-5286}} | ||
| + | {{#set: reversible reaction associated=RXN1F-10|RXN1F-66}} | ||
Latest revision as of 19:29, 21 March 2018
Contents
Metabolite CHLOROPHYLLIDE-A
- smiles:
- C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
- common name:
- chlorophyllide a
- molecular weight:
- 612.967
- Synonym(s):
- chlorophyllide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.
