Difference between revisions of "PWY-5386"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-21 CPD66-21] == * smiles: ** CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5386 PWY-5386] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-21 CPD66-21] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5386 PWY-5386] ==
* smiles:
+
* taxonomic range:
** CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O)O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
** InChIKey=YEESKJGWJFYOOK-IJHYULJSSA-M
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
** leukotriene-D4
+
** methylglyoxal degradation I
* molecular weight:
+
** 495.653   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''3''' reactions in the full pathway
* [[RXN66-336]]
+
* [[GLYOXI-RXN]]
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
 +
*** [[Tiso_gene_10185]]
 +
*** [[Tiso_gene_7507]]
 +
*** [[Tiso_gene_19902]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
* [[GLYOXII-RXN]]
 +
** 5 associated gene(s):
 +
*** [[Tiso_gene_10895]]
 +
*** [[Tiso_gene_5281]]
 +
*** [[Tiso_gene_19886]]
 +
*** [[Tiso_gene_12304]]
 +
*** [[Tiso_gene_10894]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=DLACTDEHYDROGFAD-RXN DLACTDEHYDROGFAD-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940265 52940265]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-5386 PWY-5386]
* CHEBI:
+
{{#set: taxonomic range=TAX-33208}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63166 63166]
+
{{#set: taxonomic range=TAX-4751}}
{{#set: smiles=CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O)O}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: inchi key=InChIKey=YEESKJGWJFYOOK-IJHYULJSSA-M}}
+
{{#set: common name=methylglyoxal degradation I}}
{{#set: common name=leukotriene-D4}}
+
{{#set: reaction found=2}}
{{#set: molecular weight=495.653    }}
+
{{#set: total reaction=3}}
{{#set: produced by=RXN66-336}}
+
{{#set: completion rate=67.0}}

Latest revision as of 19:29, 21 March 2018

Pathway PWY-5386

Reaction(s) found

2 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links