Difference between revisions of "Tiso gene 8689"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] == * smiles: ** C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1) * inchi key: **...") |
(Created page with "Category:Gene == Gene Tiso_gene_8689 == * Synonym(s): == Reactions associated == * Reaction: 3.2.1.39-RXN ** Source: orthology-esiliculosus == Pathways associated...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_8689 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[3.2.1.39-RXN]] |
− | == | + | ** Source: [[orthology-esiliculosus]] |
− | + | == Pathways associated == | |
== External links == | == External links == | ||
− | + | {{#set: reaction associated=3.2.1.39-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 19:29, 21 March 2018
Gene Tiso_gene_8689
- Synonym(s):
Reactions associated
- Reaction: 3.2.1.39-RXN
- Source: orthology-esiliculosus