Difference between revisions of "CPD-7006"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1334 PWY0-1334] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7006 CPD-7006] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7006 CPD-7006] == |
− | * | + | * smiles: |
− | ** [ | + | ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9)))) |
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** tetrahydrogeranylgeranyl chlorophyll a |
+ | * inchi key: | ||
+ | ** InChIKey=NVDIDZKEPDPXJJ-ONWAGYJKSA-M | ||
+ | * molecular weight: | ||
+ | ** 890.479 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** tetrahydroGG-chlorophyll a | ||
+ | ** tetrahydroGG-chl a | ||
+ | ** tetrahydrogeranylgeranyl-chl a | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-7666]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | * [[RXN-7665]] |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926313 46926313] |
− | {{#set: | + | {{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}} |
− | {{#set: | + | {{#set: common name=tetrahydrogeranylgeranyl chlorophyll a}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=NVDIDZKEPDPXJJ-ONWAGYJKSA-M}} |
− | {{#set: | + | {{#set: molecular weight=890.479 }} |
− | {{#set: | + | {{#set: common name=tetrahydroGG-chlorophyll a|tetrahydroGG-chl a|tetrahydrogeranylgeranyl-chl a}} |
+ | {{#set: consumed by=RXN-7666}} | ||
+ | {{#set: produced by=RXN-7665}} |
Latest revision as of 20:29, 21 March 2018
Contents
Metabolite CPD-7006
- smiles:
- C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
- common name:
- tetrahydrogeranylgeranyl chlorophyll a
- inchi key:
- InChIKey=NVDIDZKEPDPXJJ-ONWAGYJKSA-M
- molecular weight:
- 890.479
- Synonym(s):
- tetrahydroGG-chlorophyll a
- tetrahydroGG-chl a
- tetrahydrogeranylgeranyl-chl a
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.