|
|
(2 intermediate revisions by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CITSYN-RXN CITSYN-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15361 CPD-15361] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** CCCCCCCCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| * common name: | | * common name: |
− | ** citrate_synthase | + | ** 3R-hydroxy-(11Z)-eicos-11-enoyl-CoA |
− | * ec number: | + | * inchi key: |
− | ** [http://enzyme.expasy.org/EC/2.3.3.16 EC-2.3.3.16] | + | ** InChIKey=PREOMQKNJXWCLZ-ZHLMIUQRSA-J |
− | ** [http://enzyme.expasy.org/EC/2.3.3.1 EC-2.3.3.1] | + | * molecular weight: |
| + | ** 1072.006 |
| * Synonym(s): | | * Synonym(s): |
− | ** Condensing enzyme
| |
− | ** citrate synthesis
| |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | == Reaction(s) known to produce the compound == |
− | ** 1 [[OXALACETIC_ACID]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[ACETYL-COA]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[CIT]][c]
| + | * [[RXN-14484]] |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 oxaloacetate[c] '''+''' 1 H2O[c] '''+''' 1 acetyl-CoA[c] '''=>''' 1 H+[c] '''+''' 1 coenzyme A[c] '''+''' 1 citrate[c]
| + | |
− | | + | |
− | == Genes associated with this reaction ==
| + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_9603]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_9602]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_9601]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_18030]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | == Pathways ==
| + | |
− | * [[PWY-5750]], itaconate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5750 PWY-5750]
| + | |
− | ** '''3''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-5913]], partial TCA cycle (obligate autotrophs): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5913 PWY-5913]
| + | |
− | ** '''9''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[GLYOXYLATE-BYPASS]], glyoxylate cycle: [http://metacyc.org/META/NEW-IMAGE?object=GLYOXYLATE-BYPASS GLYOXYLATE-BYPASS]
| + | |
− | ** '''6''' reactions found over '''6''' reactions in the full pathway
| + | |
− | * [[REDCITCYC]], TCA cycle VIII (helicobacter): [http://metacyc.org/META/NEW-IMAGE?object=REDCITCYC REDCITCYC]
| + | |
− | ** '''6''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[TCA]], TCA cycle I (prokaryotic): [http://metacyc.org/META/NEW-IMAGE?object=TCA TCA]
| + | |
− | ** '''7''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[P105-PWY]], TCA cycle IV (2-oxoglutarate decarboxylase): [http://metacyc.org/META/NEW-IMAGE?object=P105-PWY P105-PWY]
| + | |
− | ** '''9''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[PWY-6969]], TCA cycle V (2-oxoglutarate:ferredoxin oxidoreductase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6969 PWY-6969]
| + | |
− | ** '''9''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[FERMENTATION-PWY]], mixed acid fermentation: [http://metacyc.org/META/NEW-IMAGE?object=FERMENTATION-PWY FERMENTATION-PWY]
| + | |
− | ** '''9''' reactions found over '''16''' reactions in the full pathway
| + | |
− | * [[PWY-6728]], methylaspartate cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6728 PWY-6728] | + | |
− | ** '''11''' reactions found over '''18''' reactions in the full pathway
| + | |
− | * [[PWY-6549]], L-glutamine biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6549 PWY-6549]
| + | |
− | ** '''6''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY-7254]], TCA cycle VII (acetate-producers): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7254 PWY-7254]
| + | |
− | ** '''5''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY-7124]], ethylene biosynthesis V (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7124 PWY-7124]
| + | |
− | ** '''7''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[PWY66-398]], TCA cycle III (animals): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-398 PWY66-398]
| + | |
− | ** '''10''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[PWY-5690]], TCA cycle II (plants and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5690 PWY-5690]
| + | |
− | ** '''6''' reactions found over '''9''' reactions in the full pathway
| + | |
− | == Reconstruction information ==
| + | |
− | * [[manual]]:
| + | |
− | ** [[primary_network]]
| + | |
− | * [[annotation]]:
| + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[experimental_annotation]]
| + | |
− | *** [[in-silico_annotation]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16845 16845] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193763 72193763] |
− | * LIGAND-RXN:
| + | * CHEBI: |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00351 R00351]
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76387 76387] |
− | * PIR:
| + | {{#set: smiles=CCCCCCCCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A43936 A43936]
| + | {{#set: common name=3R-hydroxy-(11Z)-eicos-11-enoyl-CoA}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A81200 A81200] | + | {{#set: inchi key=InChIKey=PREOMQKNJXWCLZ-ZHLMIUQRSA-J}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=B81139 B81139] | + | {{#set: molecular weight=1072.006 }} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=E64760 E64760]
| + | {{#set: produced by=RXN-14484}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=F86708 F86708]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=G69600 G69600]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=G81265 G81265]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=I39506 I39506]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=I40044 I40044]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=I40380 I40380]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=I40717 I40717]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=JQ1392 JQ1392]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=PQ0046 PQ0046]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S41527 S41527]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S41563 S41563]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S42370 S42370]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S44316 S44316]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S52814 S52814]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T02390 T02390]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T09334 T09334]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T44615 T44615]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=YKBY YKBY]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=YKBYC YKBYC]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=YKEC YKEC]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=YKMUM YKMUM]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=YKMY YKMY]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=YKPG YKPG]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=YKPSCA YKPSCA]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=YKQPC YKQPC]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=YKRECP YKRECP]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=YKYT YKYT]
| + | |
− | * UNIPROT:
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JRA5 Q9JRA5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JQX0 Q9JQX0]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31660 P31660]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9CHQ6 Q9CHQ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/P39120 P39120]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PLZ5 Q9PLZ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20902 P20902]
| + | |
− | ** [http://www.uniprot.org/uniprot/P51033 P51033]
| + | |
− | ** [http://www.uniprot.org/uniprot/P39119 P39119]
| + | |
− | ** [http://www.uniprot.org/uniprot/P42457 P42457]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18789 P18789]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20903 P20903]
| + | |
− | ** [http://www.uniprot.org/uniprot/P51038 P51038]
| + | |
− | ** [http://www.uniprot.org/uniprot/P34085 P34085]
| + | |
− | ** [http://www.uniprot.org/uniprot/P34575 P34575]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43175 Q43175]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43635 P43635]
| + | |
− | ** [http://www.uniprot.org/uniprot/O24259 O24259]
| + | |
− | ** [http://www.uniprot.org/uniprot/O32705 O32705]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00890 P00890]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08679 P08679]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0ABH7 P0ABH7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q47237 Q47237]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20115 P20115]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26491 P26491]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00889 P00889]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20901 P20901]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09948 P09948]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21553 P21553]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}}
| + | |
− | {{#set: common name=citrate_synthase}} | + | |
− | {{#set: ec number=EC-2.3.3.16}}
| + | |
− | {{#set: ec number=EC-2.3.3.1}}
| + | |
− | {{#set: common name=Condensing enzyme|citrate synthesis}}
| + | |
− | {{#set: gene associated=Tiso_gene_9603|Tiso_gene_9602|Tiso_gene_9601|Tiso_gene_18030}}
| + | |
− | {{#set: in pathway=PWY-5750|PWY-5913|GLYOXYLATE-BYPASS|REDCITCYC|TCA|P105-PWY|PWY-6969|FERMENTATION-PWY|PWY-6728|PWY-6549|PWY-7254|PWY-7124|PWY66-398|PWY-5690}}
| + | |
− | {{#set: reconstruction category=manual}} | + | |
− | {{#set: reconstruction source=primary_network}}
| + | |
− | {{#set: reconstruction category=annotation}} | + | |
− | {{#set: reconstruction tool=pathwaytools}} | + | |
− | {{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
| + | |