Difference between revisions of "RXN-14131"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UBIQUINONE-8 UBIQUINONE-8] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14131 RXN-14131] == * direction: ** LEFT-TO-RIGHT * common name: ** acyl-coenzyme_a_oxidase **...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UBIQUINONE-8 UBIQUINONE-8] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14131 RXN-14131] ==
−
* smiles:
+
* direction:
−
** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(C(OC)=C(OC)C(=O)C(C)=1)=O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=ICFIZJQGJAJRSU-SGHXUWJISA-N
+
 
* common name:
 
* common name:
−
** ubiquinone-8
+
** acyl-coenzyme_a_oxidase
−
* molecular weight:
+
** acyl-_dehydrogenase
−
** 727.121   
+
** ORF
 +
** acyl-CoA_dehydrogenase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.3.8.8 EC-1.3.8.8]
 
* Synonym(s):
 
* Synonym(s):
−
** ubiquinone(8)
 
−
** coenzyme-Q8
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[NADHor_2m]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[ETF-Oxidized]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[TETRADECANOYL-COA]][c] '''=>''' 1 [[ETF-Reduced]][c] '''+''' 1 [[CPD-15568]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 an oxidized electron-transfer flavoprotein[c] '''+''' 1 H+[c] '''+''' 1 myristoyl-CoA[c] '''=>''' 1 a reduced electron-transfer flavoprotein[c] '''+''' 1 2-trans-tetradecenoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_883]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_6475]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_18566]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_16631]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_5991]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_17967]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7654]], (8E,10E)-dodeca-8,10-dienol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7654 PWY-7654]
 +
** '''6''' reactions found over '''11''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 1339-63-5
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=28359 28359]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5283546 5283546]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* LIGAND-CPD:
+
{{#set: common name=acyl-coenzyme_a_oxidase}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C17569 C17569]
+
{{#set: common name=acyl-_dehydrogenase}}
−
* CHEMSPIDER:
+
{{#set: common name=ORF}}
−
** [http://www.chemspider.com/Chemical-Structure.4446659.html 4446659]
+
{{#set: common name=acyl-CoA_dehydrogenase}}
−
* CHEBI:
+
{{#set: ec number=EC-1.3.8.8}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61683 61683]
+
{{#set: gene associated=Tiso_gene_883|Tiso_gene_6475|Tiso_gene_18566|Tiso_gene_16631|Tiso_gene_5991|Tiso_gene_17967}}
−
* BIGG : q8
+
{{#set: in pathway=PWY-7654}}
−
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(C(OC)=C(OC)C(=O)C(C)=1)=O)}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: inchi key=InChIKey=ICFIZJQGJAJRSU-SGHXUWJISA-N}}
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
−
{{#set: common name=ubiquinone-8}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: molecular weight=727.121    }}
+
−
{{#set: common name=ubiquinone(8)|coenzyme-Q8}}
+
−
{{#set: consumed by=NADHor_2m}}
+

Latest revision as of 19:05, 21 March 2018

Reaction RXN-14131

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • acyl-coenzyme_a_oxidase
    • acyl-_dehydrogenase
    • ORF
    • acyl-CoA_dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 an oxidized electron-transfer flavoprotein[c] + 1 H+[c] + 1 myristoyl-CoA[c] => 1 a reduced electron-transfer flavoprotein[c] + 1 2-trans-tetradecenoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7654, (8E,10E)-dodeca-8,10-dienol biosynthesis: PWY-7654
    • 6 reactions found over 11 reactions in the full pathway

Reconstruction information

External links






Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-14131&oldid=39382"