Difference between revisions of "RXN-11921"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15361 CPD-15361] == * smiles: ** CCCCCCCCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)CO...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11921 RXN-11921] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-methylcrotonyl-CoA:acetyl...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15361 CPD-15361] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11921 RXN-11921] ==
* smiles:
+
* direction:
** CCCCCCCCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=PREOMQKNJXWCLZ-ZHLMIUQRSA-J
+
 
* common name:
 
* common name:
** 3R-hydroxy-(11Z)-eicos-11-enoyl-CoA
+
** 3-methylcrotonyl-CoA:acetyl-CoA C-acyltransferase
* molecular weight:
+
* ec number:
** 1072.006   
+
** [http://enzyme.expasy.org/EC/2.3.1 EC-2.3.1]
 
* Synonym(s):
 
* Synonym(s):
 +
** 5-methyl-3-oxo-4-hexenoyl-CoA thiolase
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-14484]]
+
** 1 [[CO-A]][c] '''+''' 1 [[CPD-12906]][c] '''=>''' 1 [[ACETYL-COA]][c] '''+''' 1 [[3-METHYL-CROTONYL-COA]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 coenzyme A[c] '''+''' 1 5-methyl-3-oxo-4-hexenoyl-CoA[c] '''=>''' 1 acetyl-CoA[c] '''+''' 1 3-methylcrotonyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_16181]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-6672]], cis-genanyl-CoA degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6672 PWY-6672]
 +
** '''4''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* LIGAND-RXN:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193763 72193763]
+
** [http://www.genome.jp/dbget-bin/www_bget?R08095 R08095]
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76387 76387]
+
{{#set: common name=3-methylcrotonyl-CoA:acetyl-CoA C-acyltransferase}}
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: ec number=EC-2.3.1}}
{{#set: inchi key=InChIKey=PREOMQKNJXWCLZ-ZHLMIUQRSA-J}}
+
{{#set: common name=5-methyl-3-oxo-4-hexenoyl-CoA thiolase}}
{{#set: common name=3R-hydroxy-(11Z)-eicos-11-enoyl-CoA}}
+
{{#set: gene associated=Tiso_gene_16181}}
{{#set: molecular weight=1072.006    }}
+
{{#set: in pathway=PWY-6672}}
{{#set: produced by=RXN-14484}}
+
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph}}

Latest revision as of 19:30, 21 March 2018

Reaction RXN-11921

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-methylcrotonyl-CoA:acetyl-CoA C-acyltransferase
  • ec number:
  • Synonym(s):
    • 5-methyl-3-oxo-4-hexenoyl-CoA thiolase

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6672, cis-genanyl-CoA degradation: PWY-6672
    • 4 reactions found over 9 reactions in the full pathway

Reconstruction information

External links