Difference between revisions of "RXN1G-460"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLUCOSE ALPHA-GLUCOSE] == * smiles: ** C(O)C1(OC(C(C(C1O)O)O)O) * inchi key: ** InChIKey=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-460 RXN1G-460] == * direction: ** REVERSIBLE * common name: ** 3-oxoacyl-synthase * ec number...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLUCOSE ALPHA-GLUCOSE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-460 RXN1G-460] ==
* smiles:
+
* direction:
** C(O)C1(OC(C(C(C1O)O)O)O)
+
** REVERSIBLE
* inchi key:
+
** InChIKey=WQZGKKKJIJFFOK-DVKNGEFBSA-N
+
 
* common name:
 
* common name:
** α-D-glucopyranose
+
** 3-oxoacyl-synthase
* molecular weight:
+
* ec number:
** 180.157   
+
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
 
* Synonym(s):
 
* Synonym(s):
** α-glucose
 
** α-D-glucose
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-1685]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[MALONYL-ACP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD-9965]][c] '''<=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[3-oxo-behenoyl-ACPs]][c] '''+''' 1 [[CO-A]][c]
* [[RXN-14349]]
+
* With common name(s):
* [[TREHALA-RXN]]
+
** 1 a malonyl-[acp][c] '''+''' 1 H+[c] '''+''' 1 icosanoyl-CoA[c] '''<=>''' 1 CO2[c] '''+''' 1 a 3-oxo-behenoyl-[acp][c] '''+''' 1 coenzyme A[c]
* [[3.2.1.58-RXN]]
+
 
* [[RXN-2141]]
+
== Genes associated with this reaction  ==
== Reaction(s) of unknown directionality ==
+
Genes have been associated with this reaction based on different elements listed below.
* [[ALDOSE-1-EPIMERASE-RXN]]
+
* Gene: [[Tiso_gene_14485]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_15991]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_5939]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_19302]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=79025 79025]
+
{{#set: common name=3-oxoacyl-synthase}}
* HMDB : HMDB03345
+
{{#set: ec number=EC-2.3.1.41}}
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_14485|Tiso_gene_15991|Tiso_gene_5939|Tiso_gene_19302}}
** [http://www.genome.jp/dbget-bin/www_bget?C00267 C00267]
+
{{#set: in pathway=}}
* CHEMSPIDER:
+
{{#set: reconstruction category=orthology|annotation}}
** [http://www.chemspider.com/Chemical-Structure.71358.html 71358]
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}}
* CHEBI:
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17925 17925]
+
* METABOLIGHTS : MTBLC17925
+
{{#set: smiles=C(O)C1(OC(C(C(C1O)O)O)O)}}
+
{{#set: inchi key=InChIKey=WQZGKKKJIJFFOK-DVKNGEFBSA-N}}
+
{{#set: common name=&alpha;-D-glucopyranose}}
+
{{#set: molecular weight=180.157    }}
+
{{#set: common name=&alpha;-glucose|&alpha;-D-glucose}}
+
{{#set: consumed by=RXN-1685}}
+
{{#set: produced by=RXN-14349|TREHALA-RXN|3.2.1.58-RXN|RXN-2141}}
+
{{#set: consumed or produced by=ALDOSE-1-EPIMERASE-RXN}}
+

Latest revision as of 19:30, 21 March 2018

Reaction RXN1G-460

  • direction:
    • REVERSIBLE
  • common name:
    • 3-oxoacyl-synthase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links