Difference between revisions of "RXN-11057"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PORPHOBILINOGEN PORPHOBILINOGEN] == * smiles: ** C(C1(=C(C(=CN1)CCC(=O)[O-])CC(=O)[O-]))[N+] *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11057 RXN-11057] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11057 RXN-11057] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/1.14.14.1 EC-1.14.14.1] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[Red-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[N-ACETYL-5-METHOXY-TRYPTAMINE]][c] '''=>''' 1 [[FORMALDEHYDE]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[N-ACETYL-SEROTONIN]][c] '''+''' 1 [[Ox-NADPH-Hemoprotein-Reductases]][c] |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** 1 oxygen[c] '''+''' 1 a reduced [NADPH-hemoprotein reductase][c] '''+''' 1 melatonin[c] '''=>''' 1 formaldehyde[c] '''+''' 1 H2O[c] '''+''' 1 N-acetyl-serotonin[c] '''+''' 1 an oxidized [NADPH-hemoprotein reductase][c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_1035]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | == Pathways == | ||
| + | * [[PWY-6398]], melatonin degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6398 PWY-6398] | ||
| + | ** '''5''' reactions found over '''5''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: ec number=EC-1.14.14.1}} | |
| − | + | {{#set: gene associated=Tiso_gene_1035}} | |
| − | + | {{#set: in pathway=PWY-6398}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-esiliculosus}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:30, 21 March 2018
Contents
Reaction RXN-11057
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 OXYGEN-MOLECULE[c] + 1 Red-NADPH-Hemoprotein-Reductases[c] + 1 N-ACETYL-5-METHOXY-TRYPTAMINE[c] => 1 FORMALDEHYDE[c] + 1 WATER[c] + 1 N-ACETYL-SEROTONIN[c] + 1 Ox-NADPH-Hemoprotein-Reductases[c]
- With common name(s):
- 1 oxygen[c] + 1 a reduced [NADPH-hemoprotein reductase][c] + 1 melatonin[c] => 1 formaldehyde[c] + 1 H2O[c] + 1 N-acetyl-serotonin[c] + 1 an oxidized [NADPH-hemoprotein reductase][c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_1035
- Source: orthology-esiliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
