Difference between revisions of "CPD-706"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_CU+ TransportSeed_CU+] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Fo...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-706 CPD-706] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_CU+ TransportSeed_CU+] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-706 CPD-706] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
 +
* common name:
 +
** 24-methylenecholesterol
 +
* inchi key:
 +
** InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N
 +
* molecular weight:
 +
** 398.671   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1.0 [[CU+]][e] '''=>''' 1.0 [[CU+]][c]
+
* [[RXN-707]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1.0 Cu+[e] '''=>''' 1.0 Cu+[c]
+
 
+
== Genes associated with this reaction  ==
+
== Pathways  ==
+
== Reconstruction information  ==
+
* [[manual]]:
+
** [[added to manage seeds from extracellular to cytosol compartment]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: in pathway=}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=92113 92113]
{{#set: reconstruction category=manual}}
+
* HMDB : HMDB06849
{{#set: reconstruction source=added to manage seeds from extracellular to cytosol compartment}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C15781 C15781]
 +
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: common name=24-methylenecholesterol}}
 +
{{#set: inchi key=InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N}}
 +
{{#set: molecular weight=398.671    }}
 +
{{#set: produced by=RXN-707}}

Latest revision as of 20:31, 21 March 2018

Metabolite CPD-706

  • smiles:
    • CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • common name:
    • 24-methylenecholesterol
  • inchi key:
    • InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N
  • molecular weight:
    • 398.671
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.