Difference between revisions of "S-ADENOSYLMETHIONINAMINE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_1377 == * left end position: ** 21535 * transcription direction: ** POSITIVE * right end position: ** 22785 * centisome position: ** 89.643...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ADENOSYLMETHIONINAMINE S-ADENOSYLMETHIONINAMINE] == * smiles: ** C[S+](CCC[N+])CC1(OC(C(O)C(O...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ADENOSYLMETHIONINAMINE S-ADENOSYLMETHIONINAMINE] == |
− | * | + | * smiles: |
− | ** | + | ** C[S+](CCC[N+])CC1(OC(C(O)C(O)1)N3(C=NC2(=C(N)N=CN=C23))) |
− | * | + | * common name: |
− | ** | + | ** S-adenosyl 3-(methylthio)propylamine |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=ZUNBITIXDCPNSD-LSRJEVITSA-O |
− | * | + | * molecular weight: |
− | ** | + | ** 356.442 |
* Synonym(s): | * Synonym(s): | ||
+ | ** S-adenosyl-(5')-3-methylthiopropylamine | ||
+ | ** dcSAM | ||
+ | ** decarboxylated AdoMet | ||
+ | ** (5-deoxy-5-adenosyl)(3-aminopropyl) methylsulfonium salt | ||
+ | ** decarboxylated SAM | ||
+ | ** S-adenosylmethioninamine | ||
+ | ** decarboxylated S-adenosylmethionine | ||
+ | ** dAdoMet | ||
+ | ** S-methyl-S-adenosyl homocysteamine | ||
+ | ** 3-amino-propyl-S-adenosine | ||
+ | ** S-adenosyl-L-methioninamine | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[APAPT]] |
− | * | + | * [[SPERMINE-SYNTHASE-RXN]] |
− | + | * [[RXN0-5217]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[AMCL]] | |
− | + | * [[SAMDECARB-RXN]] | |
− | == | + | == Reaction(s) of unknown directionality == |
− | * [[ | + | * [[SPERMIDINESYN-RXN]] |
− | * [[ | + | |
== External links == | == External links == | ||
− | {{#set: | + | * BIGG : ametam |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203490 25203490] |
− | {{#set: | + | * HMDB : HMDB00988 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01137 C01137] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57443 57443] | ||
+ | * METABOLIGHTS : MTBLC57443 | ||
+ | {{#set: smiles=C[S+](CCC[N+])CC1(OC(C(O)C(O)1)N3(C=NC2(=C(N)N=CN=C23)))}} | ||
+ | {{#set: common name=S-adenosyl 3-(methylthio)propylamine}} | ||
+ | {{#set: inchi key=InChIKey=ZUNBITIXDCPNSD-LSRJEVITSA-O}} | ||
+ | {{#set: molecular weight=356.442 }} | ||
+ | {{#set: common name=S-adenosyl-(5')-3-methylthiopropylamine|dcSAM|decarboxylated AdoMet|(5-deoxy-5-adenosyl)(3-aminopropyl) methylsulfonium salt|decarboxylated SAM|S-adenosylmethioninamine|decarboxylated S-adenosylmethionine|dAdoMet|S-methyl-S-adenosyl homocysteamine|3-amino-propyl-S-adenosine|S-adenosyl-L-methioninamine}} | ||
+ | {{#set: consumed by=APAPT|SPERMINE-SYNTHASE-RXN|RXN0-5217}} | ||
+ | {{#set: produced by=AMCL|SAMDECARB-RXN}} | ||
+ | {{#set: reversible reaction associated=SPERMIDINESYN-RXN}} |
Latest revision as of 19:31, 21 March 2018
Contents
Metabolite S-ADENOSYLMETHIONINAMINE
- smiles:
- C[S+](CCC[N+])CC1(OC(C(O)C(O)1)N3(C=NC2(=C(N)N=CN=C23)))
- common name:
- S-adenosyl 3-(methylthio)propylamine
- inchi key:
- InChIKey=ZUNBITIXDCPNSD-LSRJEVITSA-O
- molecular weight:
- 356.442
- Synonym(s):
- S-adenosyl-(5')-3-methylthiopropylamine
- dcSAM
- decarboxylated AdoMet
- (5-deoxy-5-adenosyl)(3-aminopropyl) methylsulfonium salt
- decarboxylated SAM
- S-adenosylmethioninamine
- decarboxylated S-adenosylmethionine
- dAdoMet
- S-methyl-S-adenosyl homocysteamine
- 3-amino-propyl-S-adenosine
- S-adenosyl-L-methioninamine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : ametam
- PUBCHEM:
- HMDB : HMDB00988
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57443
"C[S+](CCC[N+])CC1(OC(C(O)C(O)1)N3(C=NC2(=C(N)N=CN=C23)))" cannot be used as a page name in this wiki.