Difference between revisions of "CPD-19157"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5265 RXN0-5265] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19157 CPD-19157] == * smiles: ** CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5265 RXN0-5265] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19157 CPD-19157] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* common name:
 +
** 3-oxo-(7Z)-tetradecenoyl-CoA
 +
* inchi key:
 +
** InChIKey=BEPLLRGJVXAEJI-TWAFKMGKSA-J
 +
* molecular weight:
 +
** 985.829   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-oxo-14:1-Δ7-CoA
 +
** 3-oxo-7-cis-tetradecenoyl-CoA
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-17795]]
** 4 [[PROTON]][c] '''+''' 4 [[E-]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 2 [[WATER]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN-17794]]
**
+
== Reaction(s) of unknown directionality ==
== Genes associated with this reaction  ==
+
== Pathways  ==
+
== Reconstruction information  ==
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[experimental_annotation]]
+
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: in pathway=}}
+
{{#set: common name=3-oxo-(7Z)-tetradecenoyl-CoA}}
{{#set: reconstruction category=annotation}}
+
{{#set: inchi key=InChIKey=BEPLLRGJVXAEJI-TWAFKMGKSA-J}}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: molecular weight=985.829    }}
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+
{{#set: common name=3-oxo-14:1-Δ7-CoA|3-oxo-7-cis-tetradecenoyl-CoA}}
 +
{{#set: consumed by=RXN-17795}}
 +
{{#set: produced by=RXN-17794}}

Latest revision as of 19:05, 21 March 2018

Metabolite CPD-19157

  • smiles:
    • CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • common name:
    • 3-oxo-(7Z)-tetradecenoyl-CoA
  • inchi key:
    • InChIKey=BEPLLRGJVXAEJI-TWAFKMGKSA-J
  • molecular weight:
    • 985.829
  • Synonym(s):
    • 3-oxo-14:1-Δ7-CoA
    • 3-oxo-7-cis-tetradecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.