Difference between revisions of "CPD-17324"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CHD-RXN CHD-RXN] == * direction: ** REVERSIBLE * common name: ** glucose-methanol-choline_oxidoredu...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17324 CPD-17324] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17324 CPD-17324] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
* common name: | * common name: | ||
| − | ** | + | ** 3-oxo adrenoyl-CoA |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=VMAJWSSWCPBIJY-KPOVBLHLSA-J |
| + | * molecular weight: | ||
| + | ** 1091.996 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 3-oxo-(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl-CoA | ||
| + | ** 3-oxo-(7Z,10Z,13Z,16Z)-docosatetraenoyl-CoA | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-16112]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581099 71581099] |
| − | * | + | * CHEBI: |
| − | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73852 73852] |
| − | + | {{#set: smiles=CCCCCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | |
| − | + | {{#set: common name=3-oxo adrenoyl-CoA}} | |
| − | {{#set: | + | {{#set: inchi key=InChIKey=VMAJWSSWCPBIJY-KPOVBLHLSA-J}} |
| − | {{#set: common name= | + | {{#set: molecular weight=1091.996 }} |
| − | {{#set: | + | {{#set: common name=3-oxo-(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl-CoA|3-oxo-(7Z,10Z,13Z,16Z)-docosatetraenoyl-CoA}} |
| − | {{#set: | + | {{#set: consumed by=RXN-16112}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Latest revision as of 19:32, 21 March 2018
Contents
Metabolite CPD-17324
- smiles:
- CCCCCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- 3-oxo adrenoyl-CoA
- inchi key:
- InChIKey=VMAJWSSWCPBIJY-KPOVBLHLSA-J
- molecular weight:
- 1091.996
- Synonym(s):
- 3-oxo-(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl-CoA
- 3-oxo-(7Z,10Z,13Z,16Z)-docosatetraenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
