Difference between revisions of "ISPH2-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOTETRAOSE MALTOTETRAOSE] == * smiles: ** C(C4(OC(OC3(C(OC(OC2(C(OC(OC1(C(OC(O)C(C1O)O)CO))C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ISPH2-RXN ISPH2-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF * ec number: ** [http:/...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOTETRAOSE MALTOTETRAOSE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ISPH2-RXN ISPH2-RXN] ==
−
* smiles:
+
* direction:
−
** C(C4(OC(OC3(C(OC(OC2(C(OC(OC1(C(OC(O)C(C1O)O)CO))C(C2O)O)CO))C(C3O)O)CO))C(C(O)C4O)O))O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=LUEWUZLMQUOBSB-AYQJAVFRSA-N
+
 
* common name:
 
* common name:
−
** maltotetraose
+
** ORF
−
* molecular weight:
+
* ec number:
−
** 666.583   
+
** [http://enzyme.expasy.org/EC/1.17.7.4 EC-1.17.7.4]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN0-5182]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[HYDROXY-METHYL-BUTENYL-DIP]][c] '''+''' 2 [[Reduced-ferredoxins]][c] '''+''' 2 [[PROTON]][c] '''=>''' 1 [[DELTA3-ISOPENTENYL-PP]][c] '''+''' 1 [[WATER]][c] '''+''' 2 [[Oxidized-ferredoxins]][c]
−
* [[RXN-14284]]
+
* With common name(s):
−
* [[RXN-14281]]
+
** 1 (E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate[c] '''+''' 2 a reduced ferredoxin [iron-sulfur] cluster[c] '''+''' 2 H+[c] '''=>''' 1 isopentenyl diphosphate[c] '''+''' 1 H2O[c] '''+''' 2 an oxidized ferredoxin [iron-sulfur] cluster[c]
−
== Reaction(s) of unknown directionality ==
+
 
−
* [[GLYMALTOPHOSPHORYL-RXN]]
+
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_5609]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[NONMEVIPP-PWY]], methylerythritol phosphate pathway I: [http://metacyc.org/META/NEW-IMAGE?object=NONMEVIPP-PWY NONMEVIPP-PWY]
 +
** '''9''' reactions found over '''9''' reactions in the full pathway
 +
* [[PWY-7560]], methylerythritol phosphate pathway II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7560 PWY-7560]
 +
** '''9''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[manual]]
 +
** Source: [[manual-primary_network]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 34612-38-9
+
* LIGAND-RXN:
−
* METABOLIGHTS : MTBLC61988
+
** [http://www.genome.jp/dbget-bin/www_bget?R08209 R08209]
−
* PUBCHEM:
+
** [http://www.genome.jp/dbget-bin/www_bget?R05884 R05884]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439639 439639]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* HMDB : HMDB01296
+
{{#set: common name=ORF}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-1.17.7.4}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02052 C02052]
+
{{#set: gene associated=Tiso_gene_5609}}
−
* CHEMSPIDER:
+
{{#set: in pathway=NONMEVIPP-PWY|PWY-7560}}
−
** [http://www.chemspider.com/Chemical-Structure.393830.html 393830]
+
{{#set: reconstruction category=orthology|manual|annotation}}
−
* CHEBI:
+
{{#set: reconstruction source=annotation-experimental_annotation|orthology-esiliculosus|annotation-in-silico_annotation|orthology-athaliana|orthology-synechocystis|manual-primary_network}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28460 28460]
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
* BIGG : maltttr
+
−
{{#set: smiles=C(C4(OC(OC3(C(OC(OC2(C(OC(OC1(C(OC(O)C(C1O)O)CO))C(C2O)O)CO))C(C3O)O)CO))C(C(O)C4O)O))O}}
+
−
{{#set: inchi key=InChIKey=LUEWUZLMQUOBSB-AYQJAVFRSA-N}}
+
−
{{#set: common name=maltotetraose}}
+
−
{{#set: molecular weight=666.583    }}
+
−
{{#set: consumed by=RXN0-5182}}
+
−
{{#set: produced by=RXN-14284|RXN-14281}}
+
−
{{#set: consumed or produced by=GLYMALTOPHOSPHORYL-RXN}}
+

Latest revision as of 19:32, 21 March 2018

Reaction ISPH2-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • NONMEVIPP-PWY, methylerythritol phosphate pathway I: NONMEVIPP-PWY
    • 9 reactions found over 9 reactions in the full pathway
  • PWY-7560, methylerythritol phosphate pathway II: PWY-7560
    • 9 reactions found over 9 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ISPH2-RXN&oldid=42215"