Difference between revisions of "PGIA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17324 CPD-17324] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PGIA PGIA] == * direction: ** REVERSIBLE * common name: ** glucose-6-phosphate isomerase (g6p-A) *...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17324 CPD-17324] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PGIA PGIA] ==
−
* smiles:
+
* direction:
−
** CCCCCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=VMAJWSSWCPBIJY-KPOVBLHLSA-J
+
 
* common name:
 
* common name:
−
** 3-oxo adrenoyl-CoA
+
** glucose-6-phosphate isomerase (g6p-A)
−
* molecular weight:
+
−
** 1091.996   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxo-(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl-CoA
 
−
** 3-oxo-(7Z,10Z,13Z,16Z)-docosatetraenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-16112]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[ALPHA-GLC-6-P]][c] '''<=>''' 1.0 [[FRUCTOSE-6P]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 &alpha;-D-glucose 6-phosphate[c] '''<=>''' 1.0 &beta;-D-fructofuranose 6-phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_19480]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581099 71581099]
+
{{#set: common name=glucose-6-phosphate isomerase (g6p-A)}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_19480}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73852 73852]
+
{{#set: in pathway=}}
−
{{#set: smiles=CCCCCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: inchi key=InChIKey=VMAJWSSWCPBIJY-KPOVBLHLSA-J}}
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: common name=3-oxo adrenoyl-CoA}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: molecular weight=1091.996    }}
+
−
{{#set: common name=3-oxo-(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl-CoA|3-oxo-(7Z,10Z,13Z,16Z)-docosatetraenoyl-CoA}}
+
−
{{#set: consumed by=RXN-16112}}
+

Latest revision as of 19:32, 21 March 2018

Reaction PGIA

  • direction:
    • REVERSIBLE
  • common name:
    • glucose-6-phosphate isomerase (g6p-A)
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 α-D-glucose 6-phosphate[c] <=> 1.0 β-D-fructofuranose 6-phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PGIA&oldid=42219"